[(1R,2S,4R,5S,6R,8R,11R,12S)-5-[(2S,3aS,6aR)-5-hydroxy-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-2-yl]-2-acetyloxy-12-hydroxy-4,5-dimethylspiro[9-oxatricyclo[6.2.2.01,6]dodecane-11,2'-oxirane]-10-yl] 2-methylpropanoate
| Internal ID | a9910867-0826-45ba-a12b-a7bdda58a9e8 |
| Taxonomy | Organoheterocyclic compounds > Furofurans |
| IUPAC Name | [(1R,2S,4R,5S,6R,8R,11R,12S)-5-[(2S,3aS,6aR)-5-hydroxy-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-2-yl]-2-acetyloxy-12-hydroxy-4,5-dimethylspiro[9-oxatricyclo[6.2.2.01,6]dodecane-11,2'-oxirane]-10-yl] 2-methylpropanoate |
| SMILES (Canonical) | CC1CC(C23C(C1(C)C4CC5CC(OC5O4)O)CC(C(C26CO6)O)OC3OC(=O)C(C)C)OC(=O)C |
| SMILES (Isomeric) | C[C@@H]1C[C@@H]([C@]23[C@@H]([C@@]1(C)[C@@H]4C[C@H]5CC(O[C@H]5O4)O)C[C@H]([C@@H]([C@]26CO6)O)OC3OC(=O)C(C)C)OC(=O)C |
| InChI | InChI=1S/C26H38O10/c1-11(2)21(30)36-23-26-16(9-15(33-23)20(29)25(26)10-31-25)24(5,12(3)6-18(26)32-13(4)27)17-7-14-8-19(28)35-22(14)34-17/h11-12,14-20,22-23,28-29H,6-10H2,1-5H3/t12-,14+,15-,16-,17+,18+,19?,20+,22-,23?,24+,25-,26+/m1/s1 |
| InChI Key | AREAOTLOVQBBIQ-PYRPPVSDSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C26H38O10 |
| Molecular Weight | 510.60 g/mol |
| Exact Mass | 510.24649740 g/mol |
| Topological Polar Surface Area (TPSA) | 133.00 Ų |
| XlogP | 1.90 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 98.10% | 94.45% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.67% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.63% | 91.11% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 91.41% | 91.19% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 89.32% | 96.47% |
| CHEMBL2581 | P07339 | Cathepsin D | 89.05% | 98.95% |
| CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 87.98% | 95.71% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 87.89% | 85.14% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 86.57% | 97.09% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 85.75% | 96.77% |
| CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 84.90% | 98.75% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 84.13% | 97.14% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 84.12% | 92.62% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 84.12% | 91.07% |
| CHEMBL1293316 | Q9HBX9 | Relaxin receptor 1 | 84.07% | 82.50% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 83.94% | 89.00% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 82.07% | 99.23% |
| CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 81.78% | 89.50% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 80.77% | 95.56% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 80.65% | 82.69% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 80.07% | 96.95% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Scutellaria caucasica |
| PubChem | 102007892 |
| LOTUS | LTS0075167 |
| wikiData | Q104917257 |