2,6,10,10-Tetramethyl-1-oxaspiro[4.5]dec-6-en-8-ol
Internal ID | 33cc3c7c-52d4-46c8-bb9f-fe24d5d3e2c9 |
Taxonomy | Organoheterocyclic compounds > Oxolanes |
IUPAC Name | 2,6,6,10-tetramethyl-1-oxaspiro[4.5]dec-9-en-8-ol |
SMILES (Canonical) | CC1CCC2(O1)C(=CC(CC2(C)C)O)C |
SMILES (Isomeric) | CC1CCC2(O1)C(=CC(CC2(C)C)O)C |
InChI | InChI=1S/C13H22O2/c1-9-7-11(14)8-12(3,4)13(9)6-5-10(2)15-13/h7,10-11,14H,5-6,8H2,1-4H3 |
InChI Key | AVMRWEITZUAUJV-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C13H22O2 |
Molecular Weight | 210.31 g/mol |
Exact Mass | 210.161979940 g/mol |
Topological Polar Surface Area (TPSA) | 29.50 Ų |
XlogP | 1.90 |
116296-78-7 |
2,6,10,10-Tetramethyl-1-oxaspiro[4.5]dec-6-en-8-ol |
DTXSID90766502 |
AVMRWEITZUAUJV-UHFFFAOYSA-N |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.33% | 96.09% |
CHEMBL4803 | P29474 | Nitric-oxide synthase, endothelial | 90.29% | 86.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 87.91% | 97.09% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 85.37% | 100.00% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 85.17% | 91.11% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 84.99% | 95.56% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 83.72% | 97.25% |
CHEMBL4072 | P07858 | Cathepsin B | 82.23% | 93.67% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.14% | 95.89% |
CHEMBL1871 | P10275 | Androgen Receptor | 81.00% | 96.43% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Vitis vinifera |
PubChem | 71339001 |
LOTUS | LTS0245670 |
wikiData | Q105331222 |