2,6-Pyridinedicarboxylic acid
| Internal ID | 77e77b0f-ab6b-4d0c-951f-f8e68cc6e86e |
| Taxonomy | Organoheterocyclic compounds > Pyridines and derivatives > Pyridinecarboxylic acids and derivatives > Pyridinecarboxylic acids |
| IUPAC Name | pyridine-2,6-dicarboxylic acid |
| SMILES (Canonical) | C1=CC(=NC(=C1)C(=O)O)C(=O)O |
| SMILES (Isomeric) | C1=CC(=NC(=C1)C(=O)O)C(=O)O |
| InChI | InChI=1S/C7H5NO4/c9-6(10)4-2-1-3-5(8-4)7(11)12/h1-3H,(H,9,10)(H,11,12) |
| InChI Key | WJJMNDUMQPNECX-UHFFFAOYSA-N |
| Popularity | 2,500 references in papers |
| Molecular Formula | C7H5NO4 |
| Molecular Weight | 167.12 g/mol |
| Exact Mass | 167.02185764 g/mol |
| Topological Polar Surface Area (TPSA) | 87.50 Ų |
| XlogP | 0.60 |
| 499-83-2 |
| PYRIDINE-2,6-DICARBOXYLIC ACID |
| Dipicolinic acid |
| 2,6-Dipicolinic acid |
| Dipicolinate |
| 2,6-Dicarboxypyridine |
| 2,6-pyridinedicarboxylate |
| MFCD00006299 |
| UE81S5CQ0G |
| CHEMBL284104 |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL1293277 | O15118 | Niemann-Pick C1 protein | 91.55% | 81.11% |
| CHEMBL1811 | P34995 | Prostanoid EP1 receptor | 90.57% | 95.71% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 86.74% | 99.23% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.52% | 95.56% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.03% | 86.33% |
| CHEMBL1293294 | P51151 | Ras-related protein Rab-9A | 83.72% | 87.67% |
| CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 82.67% | 94.62% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 80.54% | 96.09% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 10367 |
| LOTUS | LTS0069297 |
| wikiData | Q417164 |