2,6-Dimethoxy-4-[2-(3-methoxyphenyl)ethyl]phenol
| Internal ID | c7213400-14a8-4065-a438-8099e0d809b6 |
| Taxonomy | Phenylpropanoids and polyketides > Stilbenes |
| IUPAC Name | 2,6-dimethoxy-4-[2-(3-methoxyphenyl)ethyl]phenol |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C17H20O4/c1-19-14-6-4-5-12(9-14)7-8-13-10-15(20-2)17(18)16(11-13)21-3/h4-6,9-11,18H,7-8H2,1-3H3 |
| InChI Key | PHWXLXPIQUQYHN-UHFFFAOYSA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C17H20O4 |
| Molecular Weight | 288.34 g/mol |
| Exact Mass | 288.13615911 g/mol |
| Topological Polar Surface Area (TPSA) | 47.90 Ų |
| XlogP | 3.70 |
| There are no found synonyms. |
![2D Structure of 2,6-Dimethoxy-4-[2-(3-methoxyphenyl)ethyl]phenol](https://plantaedb.com/storage/docs/compounds/2023/11/26-dimethoxy-4-2-3-methoxyphenylethylphenol.jpg "2D Structure of 2,6-Dimethoxy-4-[2-(3-methoxyphenyl)ethyl]phenol")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.69% | 96.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 95.83% | 98.95% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.11% | 91.11% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.68% | 86.33% |
| CHEMBL2535 | P11166 | Glucose transporter | 89.18% | 98.75% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.22% | 95.56% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 87.98% | 99.17% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 87.18% | 94.73% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 86.62% | 94.00% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 85.95% | 99.15% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 85.91% | 92.62% |
| CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 84.92% | 86.92% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 84.53% | 93.31% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.21% | 95.89% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 82.39% | 95.89% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 81.87% | 90.00% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 81.69% | 90.20% |
| CHEMBL3231 | Q13464 | Rho-associated protein kinase 1 | 80.75% | 95.55% |
| CHEMBL5203 | P33316 | dUTP pyrophosphatase | 80.38% | 99.18% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Dendrobium nobile |
| PubChem | 85830339 |
| LOTUS | LTS0130295 |
| wikiData | Q105209270 |