2,6-Dihydroxy-5-methoxy-9-phenylphenalen-1-one
| Internal ID | 793a9b20-3c2e-4408-b5cf-62cb0ab22c3b |
| Taxonomy | Benzenoids > Naphthalenes > Phenylnaphthalenes |
| IUPAC Name | 2,6-dihydroxy-5-methoxy-9-phenylphenalen-1-one |
| SMILES (Canonical) | COC1=C(C2=C3C(=C1)C=C(C(=O)C3=C(C=C2)C4=CC=CC=C4)O)O |
| SMILES (Isomeric) | COC1=C(C2=C3C(=C1)C=C(C(=O)C3=C(C=C2)C4=CC=CC=C4)O)O |
| InChI | InChI=1S/C20H14O4/c1-24-16-10-12-9-15(21)20(23)18-13(11-5-3-2-4-6-11)7-8-14(17(12)18)19(16)22/h2-10,21-22H,1H3 |
| InChI Key | NJDQDGLQCUBCBX-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C20H14O4 |
| Molecular Weight | 318.30 g/mol |
| Exact Mass | 318.08920892 g/mol |
| Topological Polar Surface Area (TPSA) | 66.80 Ų |
| XlogP | 4.30 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 98.97% | 98.95% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.84% | 91.11% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 98.39% | 91.49% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 96.97% | 95.56% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 94.47% | 86.33% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 93.64% | 85.14% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 89.64% | 89.00% |
| CHEMBL2002 | P12268 | Inosine-5'-monophosphate dehydrogenase 2 | 88.94% | 98.21% |
| CHEMBL2378 | P30307 | Dual specificity phosphatase Cdc25C | 88.47% | 96.67% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 87.41% | 90.20% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 86.63% | 96.09% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 86.58% | 96.00% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 85.87% | 99.15% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 85.53% | 99.23% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 84.38% | 93.31% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 83.77% | 94.00% |
| CHEMBL2535 | P11166 | Glucose transporter | 82.64% | 98.75% |
| CHEMBL2095172 | P14867 | GABA-A receptor; alpha-1/beta-2/gamma-2 | 81.97% | 92.67% |
| CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 81.89% | 97.33% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 80.85% | 95.50% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 80.62% | 90.17% |
| CHEMBL2056 | P21728 | Dopamine D1 receptor | 80.06% | 91.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Wachendorfia thyrsiflora |
| PubChem | 71436128 |
| LOTUS | LTS0199638 |
| wikiData | Q105180098 |