(1R,10S,12S,13R,14S,16S,17S,18R)-18-acetyloxy-14-methyl-8,15-dioxido-8,15-diazoniahexacyclo[14.2.1.01,9.02,7.010,15.012,17]nonadeca-2,4,6,8-tetraene-13-carboxylic acid
| Internal ID | a3bb6232-367d-46c6-a285-ac5b5b8f71af |
| Taxonomy | Alkaloids and derivatives > Ajmaline-sarpagine alkaloids |
| IUPAC Name | (1R,10S,12S,13R,14S,16S,17S,18R)-18-acetyloxy-14-methyl-8,15-dioxido-8,15-diazoniahexacyclo[14.2.1.01,9.02,7.010,15.012,17]nonadeca-2,4,6,8-tetraene-13-carboxylic acid |
| SMILES (Canonical) | CC1C(C2CC3[N+]1(C4C2C(C5(C4)C3=[N+](C6=CC=CC=C56)[O-])OC(=O)C)[O-])C(=O)O |
| SMILES (Isomeric) | C[C@H]1[C@@H]([C@H]2C[C@@H]3[N+]1([C@@H]4[C@H]2[C@H]([C@@]5(C4)C3=[N+](C6=CC=CC=C56)[O-])OC(=O)C)[O-])C(=O)O |
| InChI | InChI=1S/C21H22N2O6/c1-9-16(20(25)26)11-7-14-18-21(12-5-3-4-6-13(12)22(18)27)8-15(23(9,14)28)17(11)19(21)29-10(2)24/h3-6,9,11,14-17,19H,7-8H2,1-2H3,(H,25,26)/t9-,11+,14-,15-,16-,17-,19+,21+,23?/m0/s1 |
| InChI Key | BZASEFCQVJQJFJ-HERWDHKLSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C21H22N2O6 |
| Molecular Weight | 398.40 g/mol |
| Exact Mass | 398.14778643 g/mol |
| Topological Polar Surface Area (TPSA) | 110.00 Ų |
| XlogP | 0.50 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.46% | 91.11% |
| CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 95.53% | 94.62% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.31% | 96.09% |
| CHEMBL245 | P20309 | Muscarinic acetylcholine receptor M3 | 91.29% | 97.53% |
| CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 91.19% | 94.08% |
| CHEMBL2581 | P07339 | Cathepsin D | 90.02% | 98.95% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.56% | 95.56% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.03% | 86.33% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 87.84% | 91.19% |
| CHEMBL216 | P11229 | Muscarinic acetylcholine receptor M1 | 85.28% | 94.23% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 82.96% | 97.09% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 82.80% | 93.56% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 81.92% | 93.00% |
| CHEMBL211 | P08172 | Muscarinic acetylcholine receptor M2 | 81.43% | 94.97% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 81.42% | 99.23% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 80.63% | 95.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Alstonia yunnanensis |
| PubChem | 163194982 |
| LOTUS | LTS0216980 |
| wikiData | Q104950318 |