17-[1-(dimethylamino)ethyl]-N,10,13-trimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-amine
Internal ID | 99efa758-26c9-41b1-b95d-58a55ac3cd76 |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Azasteroids and derivatives |
IUPAC Name | 17-[1-(dimethylamino)ethyl]-N,10,13-trimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-amine |
SMILES (Canonical) | CC(C1CCC2C1(CCC3C2CCC4C3(CCC(C4)NC)C)C)N(C)C |
SMILES (Isomeric) | CC(C1CCC2C1(CCC3C2CCC4C3(CCC(C4)NC)C)C)N(C)C |
InChI | InChI=1S/C24H44N2/c1-16(26(5)6)20-9-10-21-19-8-7-17-15-18(25-4)11-13-23(17,2)22(19)12-14-24(20,21)3/h16-22,25H,7-15H2,1-6H3 |
InChI Key | NLOJUKSOUNWUSW-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C24H44N2 |
Molecular Weight | 360.60 g/mol |
Exact Mass | 360.350449412 g/mol |
Topological Polar Surface Area (TPSA) | 15.30 Ų |
XlogP | 6.20 |
Atomic LogP (AlogP) | 5.18 |
H-Bond Acceptor | 2 |
H-Bond Donor | 1 |
Rotatable Bonds | 3 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
Human Intestinal Absorption | + | 0.9864 | 98.64% |
Caco-2 | + | 0.5098 | 50.98% |
Blood Brain Barrier | + | 0.9750 | 97.50% |
Human oral bioavailability | + | 0.6714 | 67.14% |
Subcellular localzation | Lysosomes | 0.8435 | 84.35% |
OATP2B1 inhibitior | - | 0.8590 | 85.90% |
OATP1B1 inhibitior | + | 0.8615 | 86.15% |
OATP1B3 inhibitior | + | 0.9399 | 93.99% |
MATE1 inhibitior | - | 0.7200 | 72.00% |
OCT2 inhibitior | - | 0.5000 | 50.00% |
BSEP inhibitior | - | 0.5289 | 52.89% |
P-glycoprotein inhibitior | - | 0.7097 | 70.97% |
P-glycoprotein substrate | - | 0.5268 | 52.68% |
CYP3A4 substrate | + | 0.6996 | 69.96% |
CYP2C9 substrate | - | 1.0000 | 100.00% |
CYP2D6 substrate | + | 0.6296 | 62.96% |
CYP3A4 inhibition | - | 0.7171 | 71.71% |
CYP2C9 inhibition | - | 0.8779 | 87.79% |
CYP2C19 inhibition | - | 0.8725 | 87.25% |
CYP2D6 inhibition | - | 0.9090 | 90.90% |
CYP1A2 inhibition | - | 0.9018 | 90.18% |
CYP2C8 inhibition | - | 0.8747 | 87.47% |
CYP inhibitory promiscuity | - | 0.7151 | 71.51% |
UGT catelyzed | - | 0.0000 | 0.00% |
Carcinogenicity (binary) | - | 0.8700 | 87.00% |
Carcinogenicity (trinary) | Non-required | 0.6407 | 64.07% |
Eye corrosion | - | 0.9509 | 95.09% |
Eye irritation | - | 0.9488 | 94.88% |
Skin irritation | - | 0.6466 | 64.66% |
Skin corrosion | + | 0.5938 | 59.38% |
Ames mutagenesis | - | 0.6500 | 65.00% |
Human Ether-a-go-go-Related Gene inhibition | - | 0.4766 | 47.66% |
Micronuclear | - | 0.7700 | 77.00% |
Hepatotoxicity | + | 0.6178 | 61.78% |
skin sensitisation | - | 0.7756 | 77.56% |
Respiratory toxicity | + | 0.7889 | 78.89% |
Reproductive toxicity | + | 0.5889 | 58.89% |
Mitochondrial toxicity | + | 0.8375 | 83.75% |
Nephrotoxicity | - | 0.7967 | 79.67% |
Acute Oral Toxicity (c) | III | 0.6355 | 63.55% |
Estrogen receptor binding | + | 0.9066 | 90.66% |
Androgen receptor binding | + | 0.7714 | 77.14% |
Thyroid receptor binding | + | 0.6968 | 69.68% |
Glucocorticoid receptor binding | + | 0.7535 | 75.35% |
Aromatase binding | + | 0.6977 | 69.77% |
PPAR gamma | + | 0.5482 | 54.82% |
Honey bee toxicity | - | 0.5327 | 53.27% |
Biodegradation | - | 0.9000 | 90.00% |
Crustacea aquatic toxicity | + | 0.6900 | 69.00% |
Fish aquatic toxicity | + | 0.9812 | 98.12% |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL204 | P00734 | Thrombin | 96.84% | 96.01% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.81% | 96.09% |
CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 95.49% | 96.38% |
CHEMBL237 | P41145 | Kappa opioid receptor | 94.97% | 98.10% |
CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 91.48% | 91.03% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 91.00% | 96.77% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 90.89% | 90.17% |
CHEMBL4482 | O96013 | Serine/threonine-protein kinase PAK 4 | 90.86% | 95.42% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 90.73% | 97.79% |
CHEMBL238 | Q01959 | Dopamine transporter | 90.23% | 95.88% |
CHEMBL1871 | P10275 | Androgen Receptor | 90.05% | 96.43% |
CHEMBL2094135 | Q96BI3 | Gamma-secretase | 89.92% | 98.05% |
CHEMBL233 | P35372 | Mu opioid receptor | 88.81% | 97.93% |
CHEMBL3837 | P07711 | Cathepsin L | 88.48% | 96.61% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 87.76% | 82.69% |
CHEMBL2534 | O15530 | 3-phosphoinositide dependent protein kinase-1 | 87.44% | 95.36% |
CHEMBL268 | P43235 | Cathepsin K | 86.91% | 96.85% |
CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 86.78% | 95.58% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 86.76% | 97.09% |
CHEMBL2801 | Q13557 | CaM kinase II delta | 86.62% | 84.49% |
CHEMBL202 | P00374 | Dihydrofolate reductase | 86.27% | 89.92% |
CHEMBL2007625 | O75874 | Isocitrate dehydrogenase [NADP] cytoplasmic | 86.08% | 99.00% |
CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 85.98% | 92.88% |
CHEMBL2041 | P07949 | Tyrosine-protein kinase receptor RET | 85.93% | 91.79% |
CHEMBL222 | P23975 | Norepinephrine transporter | 85.78% | 96.06% |
CHEMBL4225 | P49760 | Dual specificity protein kinase CLK2 | 85.74% | 80.96% |
CHEMBL2179 | P04062 | Beta-glucocerebrosidase | 85.72% | 85.31% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 85.30% | 100.00% |
CHEMBL5600 | P27448 | Serine/threonine-protein kinase c-TAK1 | 85.12% | 88.81% |
CHEMBL5500 | Q92831 | Histone acetyltransferase PCAF | 83.81% | 91.96% |
CHEMBL4618 | P09960 | Leukotriene A4 hydrolase | 83.72% | 97.86% |
CHEMBL2553 | Q15418 | Ribosomal protein S6 kinase alpha 1 | 83.34% | 85.11% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 83.28% | 95.93% |
CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 82.76% | 98.75% |
CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 82.56% | 92.86% |
CHEMBL4370 | P16662 | UDP-glucuronosyltransferase 2B7 | 82.53% | 100.00% |
CHEMBL3430907 | Q96GD4 | Aurora kinase B/Inner centromere protein | 82.44% | 97.50% |
CHEMBL2782 | P35610 | Acyl coenzyme A:cholesterol acyltransferase 1 | 82.25% | 91.65% |
CHEMBL4005 | P42336 | PI3-kinase p110-alpha subunit | 82.16% | 97.47% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 82.15% | 97.25% |
CHEMBL1907601 | P11802 | Cyclin-dependent kinase 4/cyclin D1 | 82.11% | 98.99% |
CHEMBL3055 | P50613 | Cyclin-dependent kinase 7 | 82.05% | 81.88% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 81.72% | 97.14% |
CHEMBL299 | P17252 | Protein kinase C alpha | 81.35% | 98.03% |
CHEMBL3920 | Q04759 | Protein kinase C theta | 81.04% | 97.69% |
CHEMBL2095194 | P08709 | Coagulation factor VII/tissue factor | 80.89% | 99.17% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 80.75% | 90.71% |
CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 80.70% | 93.04% |
CHEMBL4835 | P00338 | L-lactate dehydrogenase A chain | 80.22% | 95.34% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Sarcococca hookeriana |
Sarcococca ruscifolia |
Sarcococca saligna |
PubChem | 15558728 |
LOTUS | LTS0001862 |
wikiData | Q104888982 |