6-[5-[5-[5-[4-Hydroxy-5-[3-methoxy-6-methyl-4-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-6-methyloxan-2-yl]oxy-4-methoxy-6-methyloxan-2-yl]oxy-4-methoxy-6-methyloxan-2-yl]oxy-4-methoxy-6-methyloxan-2-yl]oxy-9,13,18-trimethyl-19,20-dioxapentacyclo[10.7.1.01,10.04,9.013,17]icosan-14-one
| Internal ID | 874284c8-d3ef-43b5-b671-6e226a609650 |
| Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbohydrates and carbohydrate conjugates > Oligosaccharides |
| IUPAC Name | 6-[5-[5-[5-[4-hydroxy-5-[3-methoxy-6-methyl-4-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-6-methyloxan-2-yl]oxy-4-methoxy-6-methyloxan-2-yl]oxy-4-methoxy-6-methyloxan-2-yl]oxy-4-methoxy-6-methyloxan-2-yl]oxy-9,13,18-trimethyl-19,20-dioxapentacyclo[10.7.1.01,10.04,9.013,17]icosan-14-one |
| SMILES (Canonical) | CC1CC(C(C(O1)OC2C(OC(CC2O)OC3C(OC(CC3OC)OC4C(OC(CC4OC)OC5C(OC(CC5OC)OC6CCC7(C(C6)CCC89C7CC(O8)C1(C(CCC1=O)C(O9)C)C)C)C)C)C)C)OC)OC1C(C(C(C(O1)CO)O)O)O |
| SMILES (Isomeric) | CC1CC(C(C(O1)OC2C(OC(CC2O)OC3C(OC(CC3OC)OC4C(OC(CC4OC)OC5C(OC(CC5OC)OC6CCC7(C(C6)CCC89C7CC(O8)C1(C(CCC1=O)C(O9)C)C)C)C)C)C)C)OC)OC1C(C(C(C(O1)CO)O)O)O |
| InChI | InChI=1S/C61H100O24/c1-27-19-40(78-57-51(67)50(66)49(65)41(26-62)79-57)56(71-12)58(72-27)83-52-29(3)73-45(21-36(52)63)80-53-31(5)75-47(23-38(53)69-10)82-55-32(6)76-48(24-39(55)70-11)81-54-30(4)74-46(22-37(54)68-9)77-34-16-17-59(7)33(20-34)15-18-61-42(59)25-44(85-61)60(8)35(28(2)84-61)13-14-43(60)64/h27-42,44-58,62-63,65-67H,13-26H2,1-12H3 |
| InChI Key | LMGPLCZDOYJDLI-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C61H100O24 |
| Molecular Weight | 1217.40 g/mol |
| Exact Mass | 1216.66045405 g/mol |
| Topological Polar Surface Area (TPSA) | 284.00 Ų |
| XlogP | 2.60 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 99.16% | 85.14% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.15% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.05% | 96.09% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 94.90% | 97.09% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 92.20% | 100.00% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 90.99% | 94.75% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 90.22% | 92.94% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 90.11% | 94.00% |
| CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 90.05% | 96.21% |
| CHEMBL2581 | P07339 | Cathepsin D | 89.29% | 98.95% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 87.42% | 92.62% |
| CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 85.02% | 97.33% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 84.96% | 97.25% |
| CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 84.96% | 91.24% |
| CHEMBL1871 | P10275 | Androgen Receptor | 84.48% | 96.43% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 84.35% | 99.23% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 83.88% | 92.50% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 83.61% | 95.89% |
| CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 83.33% | 95.83% |
| CHEMBL3430907 | Q96GD4 | Aurora kinase B/Inner centromere protein | 81.73% | 97.50% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 81.36% | 95.56% |
| CHEMBL5028 | O14672 | ADAM10 | 80.50% | 97.50% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 80.43% | 95.93% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Asclepias tuberosa |
| PubChem | 163043189 |
| LOTUS | LTS0212996 |
| wikiData | Q105153981 |