2',5,6',7-Tetrahydroxyflavane
| Internal ID | f862d1f5-6c4b-4639-8f6b-8e91fdfa0a4a |
| Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Hydroxyflavonoids > 7-hydroxyflavonoids |
| IUPAC Name | 2-(2,6-dihydroxyphenyl)-3,4-dihydro-2H-chromene-5,7-diol |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C15H14O5/c16-8-6-12(19)9-4-5-13(20-14(9)7-8)15-10(17)2-1-3-11(15)18/h1-3,6-7,13,16-19H,4-5H2 |
| InChI Key | HPXXXNRCPREQEL-UHFFFAOYSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C15H14O5 |
| Molecular Weight | 274.27 g/mol |
| Exact Mass | 274.08412354 g/mol |
| Topological Polar Surface Area (TPSA) | 90.20 Ų |
| XlogP | 2.40 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.27% | 91.11% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 93.57% | 93.40% |
| CHEMBL1929 | P47989 | Xanthine dehydrogenase | 93.31% | 96.12% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.51% | 95.56% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 89.39% | 96.09% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 87.68% | 97.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 87.53% | 98.95% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 87.01% | 92.94% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 84.28% | 93.99% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.20% | 89.00% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 83.70% | 91.49% |
| CHEMBL3227 | P41594 | Metabotropic glutamate receptor 5 | 83.36% | 96.42% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.01% | 95.89% |
| CHEMBL5203 | P33316 | dUTP pyrophosphatase | 82.39% | 99.18% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 82.23% | 100.00% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 82.05% | 99.23% |
| CHEMBL2535 | P11166 | Glucose transporter | 81.73% | 98.75% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 81.36% | 99.15% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Scutellaria baicalensis |
| PubChem | 92043131 |
| LOTUS | LTS0100447 |
| wikiData | Q105032032 |