(2-Ethenyl-3,10a-dihydroxy-2,4b,8,8-tetramethyl-1,3,4,4a,5,6,7,8a,9,10-decahydrophenanthren-4-yl) 2-methylbut-2-enoate
Internal ID | ebccd30e-99fb-453a-9c1d-3f7f009b9e40 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Diterpenoids |
IUPAC Name | (2-ethenyl-3,10a-dihydroxy-2,4b,8,8-tetramethyl-1,3,4,4a,5,6,7,8a,9,10-decahydrophenanthren-4-yl) 2-methylbut-2-enoate |
SMILES (Canonical) | CC=C(C)C(=O)OC1C2C3(CCCC(C3CCC2(CC(C1O)(C)C=C)O)(C)C)C |
SMILES (Isomeric) | CC=C(C)C(=O)OC1C2C3(CCCC(C3CCC2(CC(C1O)(C)C=C)O)(C)C)C |
InChI | InChI=1S/C25H40O4/c1-8-16(3)21(27)29-18-19-24(7)13-10-12-22(4,5)17(24)11-14-25(19,28)15-23(6,9-2)20(18)26/h8-9,17-20,26,28H,2,10-15H2,1,3-7H3 |
InChI Key | XVSNGASHOQELJV-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C25H40O4 |
Molecular Weight | 404.60 g/mol |
Exact Mass | 404.29265975 g/mol |
Topological Polar Surface Area (TPSA) | 66.80 Ų |
XlogP | 5.80 |
There are no found synonyms. |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.93% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.50% | 96.09% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 94.00% | 97.25% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 92.14% | 94.45% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 89.66% | 93.00% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 88.77% | 91.19% |
CHEMBL2581 | P07339 | Cathepsin D | 88.64% | 98.95% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 87.13% | 100.00% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 85.73% | 82.69% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 85.18% | 100.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.00% | 95.89% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 84.53% | 95.56% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 84.23% | 91.07% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 84.19% | 94.75% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 83.00% | 92.94% |
CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 82.91% | 93.03% |
CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 82.71% | 91.24% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 82.41% | 95.50% |
CHEMBL5028 | O14672 | ADAM10 | 81.52% | 97.50% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 80.30% | 89.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Senecio subrubriflorus |
PubChem | 163101673 |
LOTUS | LTS0095492 |
wikiData | Q105343119 |