2',5,5'-Trihydroxy-7,8-dimethoxyflavone
| Internal ID | 32d76b4a-2592-41b1-8aec-47f2c35d01e8 |
| Taxonomy | Phenylpropanoids and polyketides > Flavonoids > O-methylated flavonoids > 8-O-methylated flavonoids |
| IUPAC Name | 2-(2,5-dihydroxyphenyl)-5-hydroxy-6,8-dimethoxychromen-4-one |
| SMILES (Canonical) | COC1=CC(=C2C(=C1O)C(=O)C=C(O2)C3=C(C=CC(=C3)O)O)OC |
| SMILES (Isomeric) | COC1=CC(=C2C(=C1O)C(=O)C=C(O2)C3=C(C=CC(=C3)O)O)OC |
| InChI | InChI=1S/C17H14O7/c1-22-13-7-14(23-2)17-15(16(13)21)11(20)6-12(24-17)9-5-8(18)3-4-10(9)19/h3-7,18-19,21H,1-2H3 |
| InChI Key | FXUDNDPRVHGUTK-UHFFFAOYSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C17H14O7 |
| Molecular Weight | 330.29 g/mol |
| Exact Mass | 330.07395278 g/mol |
| Topological Polar Surface Area (TPSA) | 105.00 Ų |
| XlogP | 2.60 |
| 90965-30-3 |
| 2-(2,5-dihydroxyphenyl)-5-hydroxy-6,8-dimethoxychromen-4-one |
| DTXSID90238335 |
| 4H-1-Benzopyran-4-one, 2-(2,5-dihydroxyphenyl)-5-hydroxy-6,8-dimethoxy- |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.40% | 91.11% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 94.35% | 94.00% |
| CHEMBL3194 | P02766 | Transthyretin | 94.16% | 90.71% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.29% | 95.56% |
| CHEMBL2581 | P07339 | Cathepsin D | 92.94% | 98.95% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 92.18% | 99.15% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 90.90% | 89.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.89% | 86.33% |
| CHEMBL1163101 | O75460 | Serine/threonine-protein kinase/endoribonuclease IRE1 | 86.48% | 98.11% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 85.90% | 99.17% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 83.09% | 90.71% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 83.08% | 90.00% |
| CHEMBL2535 | P11166 | Glucose transporter | 82.40% | 98.75% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 82.10% | 85.14% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 81.89% | 94.73% |
| CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 80.53% | 94.42% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 80.50% | 99.23% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Scutellaria rehderiana |
| PubChem | 146267 |
| LOTUS | LTS0048146 |
| wikiData | Q83120631 |