(2S,3S,4S,5R,6R)-6-[(2S,3R,4S,5S,6S)-6-carboxy-4,5-dihydroxy-2-[5-hydroxy-2-(4-hydroxy-3-methoxyphenyl)-4-oxochromen-7-yl]oxyoxan-3-yl]oxy-3,4,5-trihydroxyoxane-2-carboxylic acid
Internal ID | abbcfa70-07b9-4895-8d81-a67d6ba008b1 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glucuronides > Flavonoid-7-O-glucuronides |
IUPAC Name | (2S,3S,4S,5R,6R)-6-[(2S,3R,4S,5S,6S)-6-carboxy-4,5-dihydroxy-2-[5-hydroxy-2-(4-hydroxy-3-methoxyphenyl)-4-oxochromen-7-yl]oxyoxan-3-yl]oxy-3,4,5-trihydroxyoxane-2-carboxylic acid |
SMILES (Canonical) | COC1=C(C=CC(=C1)C2=CC(=O)C3=C(C=C(C=C3O2)OC4C(C(C(C(O4)C(=O)O)O)O)OC5C(C(C(C(O5)C(=O)O)O)O)O)O)O |
SMILES (Isomeric) | COC1=C(C=CC(=C1)C2=CC(=O)C3=C(C=C(C=C3O2)O[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)C(=O)O)O)O)O[C@H]5[C@@H]([C@H]([C@@H]([C@H](O5)C(=O)O)O)O)O)O)O |
InChI | InChI=1S/C28H28O18/c1-41-14-4-8(2-3-10(14)29)13-7-12(31)16-11(30)5-9(6-15(16)43-13)42-28-24(20(35)19(34)23(45-28)26(39)40)46-27-21(36)17(32)18(33)22(44-27)25(37)38/h2-7,17-24,27-30,32-36H,1H3,(H,37,38)(H,39,40)/t17-,18-,19-,20-,21+,22-,23-,24+,27-,28+/m0/s1 |
InChI Key | MEUYKMSNZLTEBE-BBKSNKDASA-N |
Popularity | 0 references in papers |
Molecular Formula | C28H28O18 |
Molecular Weight | 652.50 g/mol |
Exact Mass | 652.12756404 g/mol |
Topological Polar Surface Area (TPSA) | 289.00 Ų |
XlogP | -0.30 |
There are no found synonyms. |
![2D Structure of (2S,3S,4S,5R,6R)-6-[(2S,3R,4S,5S,6S)-6-carboxy-4,5-dihydroxy-2-[5-hydroxy-2-(4-hydroxy-3-methoxyphenyl)-4-oxochromen-7-yl]oxyoxan-3-yl]oxy-3,4,5-trihydroxyoxane-2-carboxylic acid 2D Structure of (2S,3S,4S,5R,6R)-6-[(2S,3R,4S,5S,6S)-6-carboxy-4,5-dihydroxy-2-[5-hydroxy-2-(4-hydroxy-3-methoxyphenyl)-4-oxochromen-7-yl]oxyoxan-3-yl]oxy-3,4,5-trihydroxyoxane-2-carboxylic acid](https://plantaedb.com/storage/docs/compounds/2023/11/2500a6d0-8641-11ee-8522-77c9394b9a3f.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.82% | 91.11% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 97.94% | 91.49% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 96.34% | 89.00% |
CHEMBL3194 | P02766 | Transthyretin | 95.10% | 90.71% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 94.41% | 94.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.86% | 95.56% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 93.85% | 85.14% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 93.38% | 86.33% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 93.30% | 99.15% |
CHEMBL2581 | P07339 | Cathepsin D | 91.54% | 98.95% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 89.25% | 97.36% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 88.45% | 99.17% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 87.44% | 90.71% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.93% | 95.89% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 84.78% | 94.45% |
CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 84.06% | 95.78% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 83.87% | 95.50% |
CHEMBL1287628 | Q9Y5S8 | NADPH oxidase 1 | 83.76% | 95.48% |
CHEMBL3401 | O75469 | Pregnane X receptor | 82.89% | 94.73% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 82.70% | 99.23% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 82.34% | 96.09% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 80.06% | 91.19% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Artemisia judaica |
Medicago sativa |
Medicago truncatula |
PubChem | 102470743 |
LOTUS | LTS0026730 |
wikiData | Q104387708 |