2,5-Dimethylfuran
| Internal ID | 1b0d73e8-db12-40f6-840c-e3f85ed45023 |
| Taxonomy | Organoheterocyclic compounds > Heteroaromatic compounds |
| IUPAC Name | 2,5-dimethylfuran |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C6H8O/c1-5-3-4-6(2)7-5/h3-4H,1-2H3 |
| InChI Key | GSNUFIFRDBKVIE-UHFFFAOYSA-N |
| Popularity | 754 references in papers |
| Molecular Formula | C6H8O |
| Molecular Weight | 96.13 g/mol |
| Exact Mass | 96.057514874 g/mol |
| Topological Polar Surface Area (TPSA) | 13.10 Ų |
| XlogP | 2.20 |
| 625-86-5 |
| Furan, 2,5-dimethyl- |
| 2,5-Dimethylfurane |
| 2,5-dimethyl-furan |
| DTXSID7022093 |
| DR5HL9OJ7Y |
| CHEBI:89052 |
| NSC-6220 |
| DTXCID102093 |
| FEMA NO. 4106 |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3401 | O75469 | Pregnane X receptor | 88.65% | 94.73% |
| CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 86.46% | 93.65% |
| CHEMBL3492 | P49721 | Proteasome Macropain subunit | 82.69% | 90.24% |
| CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 81.69% | 94.80% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Panax ginseng |
| PubChem | 12266 |
| NPASS | NPC233791 |
| ChEMBL | CHEMBL1416448 |
| LOTUS | LTS0230394 |
| wikiData | Q209267 |