2,5-Dimethoxy-2-phenyl-3,4-dihydrofuro[2,3-h]chromen-4-ol
| Internal ID | 3ed6e35e-6285-4e9c-abf9-e8f3001b785b |
| Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Furanoflavonoids and dihydrofuranoflavonoids |
| IUPAC Name | 2,5-dimethoxy-2-phenyl-3,4-dihydrofuro[2,3-h]chromen-4-ol |
| SMILES (Canonical) | COC1=C2C(CC(OC2=C3C=COC3=C1)(C4=CC=CC=C4)OC)O |
| SMILES (Isomeric) | COC1=C2C(CC(OC2=C3C=COC3=C1)(C4=CC=CC=C4)OC)O |
| InChI | InChI=1S/C19H18O5/c1-21-16-10-15-13(8-9-23-15)18-17(16)14(20)11-19(22-2,24-18)12-6-4-3-5-7-12/h3-10,14,20H,11H2,1-2H3 |
| InChI Key | JJNUOQQTGRIGHV-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C19H18O5 |
| Molecular Weight | 326.30 g/mol |
| Exact Mass | 326.11542367 g/mol |
| Topological Polar Surface Area (TPSA) | 61.10 Ų |
| XlogP | 2.80 |
| There are no found synonyms. |
![2D Structure of 2,5-Dimethoxy-2-phenyl-3,4-dihydrofuro[2,3-h]chromen-4-ol](https://plantaedb.com/storage/docs/compounds/2023/11/25-dimethoxy-2-phenyl-34-dihydrofuro23-hchromen-4-ol.jpg "2D Structure of 2,5-Dimethoxy-2-phenyl-3,4-dihydrofuro[2,3-h]chromen-4-ol")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.43% | 91.11% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 95.11% | 91.49% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.79% | 96.09% |
| CHEMBL4306 | P22460 | Voltage-gated potassium channel subunit Kv1.5 | 93.26% | 94.03% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.24% | 95.56% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 88.31% | 97.14% |
| CHEMBL2716 | Q8WUI4 | Histone deacetylase 7 | 87.98% | 89.44% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.63% | 89.00% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 87.39% | 93.99% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 86.10% | 89.62% |
| CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 85.45% | 94.62% |
| CHEMBL2581 | P07339 | Cathepsin D | 85.39% | 98.95% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 84.33% | 96.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 83.10% | 86.33% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 80.28% | 94.00% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 80.19% | 92.62% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Millettia erythrocalyx |
| PubChem | 78384845 |
| LOTUS | LTS0141361 |
| wikiData | Q105129761 |