4,5-Dihydroxynaphthalene-1,2-dione
| Internal ID | 97d8a0e0-e36c-43d8-a755-8f9838f4d049 |
| Taxonomy | Benzenoids > Naphthalenes > Naphthoquinones |
| IUPAC Name | 4,5-dihydroxynaphthalene-1,2-dione |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C10H6O4/c11-6-3-1-2-5-9(6)7(12)4-8(13)10(5)14/h1-4,11-12H |
| InChI Key | AQMHLTLDUPBBEF-UHFFFAOYSA-N |
| Popularity | 11 references in papers |
| Molecular Formula | C10H6O4 |
| Molecular Weight | 190.15 g/mol |
| Exact Mass | 190.02660867 g/mol |
| Topological Polar Surface Area (TPSA) | 74.60 Ų |
| XlogP | 1.00 |
| 4,5-dihydroxynaphthalene-1,2-dione |
| DTXSID20964190 |
| RefChem:285448 |
| DTXCID401391896 |
| 4923-55-1 |
| 2-Hydroxyjuglone |
| 1,4-Naphthalenedione, 2,5-dihydroxy- |
| 2,5-Dihydroxynaphthoquinone |
| 2,5-Dihydroxy-1,4-naphthoquinone |
| 1,4-NAPHTHOQUINONE, 2,5-DIHYDROXY- |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| CHEMBL3797 | Q13315 | Serine-protein kinase ATM |
794.3 nM |
Potency |
via Super-PRED
|
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 96.66% | 98.95% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.75% | 95.56% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 91.71% | 91.11% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 89.96% | 91.49% |
| CHEMBL2378 | P30307 | Dual specificity phosphatase Cdc25C | 88.54% | 96.67% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 88.04% | 99.23% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 87.22% | 94.75% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 85.59% | 99.15% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 85.49% | 93.03% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 80.65% | 94.73% |
| CHEMBL2535 | P11166 | Glucose transporter | 80.32% | 98.75% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 21035 |
| LOTUS | LTS0205892 |
| wikiData | Q82946123 |