2,5-diamino-N-(1-amino-1-imino-3-methylbutan-2-yl)pentanamide
| Internal ID | e2ab02df-fed3-4a18-9d2d-8a7dc121a4be |
| Taxonomy | Organic acids and derivatives > Carboximidic acids and derivatives > Carboximidic acids |
| IUPAC Name | 2,5-diamino-N-(1-amino-1-imino-3-methylbutan-2-yl)pentanamide |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C10H23N5O/c1-6(2)8(9(13)14)15-10(16)7(12)4-3-5-11/h6-8H,3-5,11-12H2,1-2H3,(H3,13,14)(H,15,16) |
| InChI Key | VWMHHNLTLJJMOG-UHFFFAOYSA-N |
| Popularity | 3 references in papers |
| Molecular Formula | C10H23N5O |
| Molecular Weight | 229.32 g/mol |
| Exact Mass | 229.19026037 g/mol |
| Topological Polar Surface Area (TPSA) | 131.00 Ų |
| XlogP | -1.20 |
| 2,5-diamino-N-(1-amino-1-imino-3-methylbutan-2-yl)pentanamide |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 98.57% | 83.82% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.97% | 96.09% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 93.59% | 100.00% |
| CHEMBL2581 | P07339 | Cathepsin D | 93.28% | 98.95% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 92.41% | 97.21% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 90.88% | 100.00% |
| CHEMBL4581 | P52732 | Kinesin-like protein 1 | 90.32% | 93.18% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 90.14% | 93.56% |
| CHEMBL4394 | Q9NYA1 | Sphingosine kinase 1 | 90.04% | 96.03% |
| CHEMBL3976 | Q9UHL4 | Dipeptidyl peptidase II | 89.39% | 92.29% |
| CHEMBL4822 | P56817 | Beta-secretase 1 | 89.34% | 97.35% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 89.07% | 99.17% |
| CHEMBL3492 | P49721 | Proteasome Macropain subunit | 88.93% | 90.24% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 88.17% | 96.47% |
| CHEMBL2094135 | Q96BI3 | Gamma-secretase | 87.96% | 98.05% |
| CHEMBL3776 | Q14790 | Caspase-8 | 87.71% | 97.06% |
| CHEMBL3437 | Q16853 | Amine oxidase, copper containing | 87.69% | 94.00% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 87.47% | 94.45% |
| CHEMBL236 | P41143 | Delta opioid receptor | 87.13% | 99.35% |
| CHEMBL3837 | P07711 | Cathepsin L | 87.00% | 96.61% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 86.74% | 97.29% |
| CHEMBL3308 | P55212 | Caspase-6 | 86.27% | 97.56% |
| CHEMBL4816 | Q9Y243 | Serine/threonine-protein kinase AKT3 | 86.24% | 96.28% |
| CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 85.71% | 89.50% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 85.52% | 94.33% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 85.49% | 90.71% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 85.39% | 98.33% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 83.25% | 91.11% |
| CHEMBL5852 | Q96P65 | Pyroglutamylated RFamide peptide receptor | 81.91% | 85.00% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 81.65% | 96.95% |
| CHEMBL1907594 | P30926 | Neuronal acetylcholine receptor; alpha3/beta4 | 80.65% | 97.23% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 80.07% | 90.20% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 139591703 |
| LOTUS | LTS0176454 |
| wikiData | Q104199852 |