(1R,3aR,9aS)-7-methoxy-3a-methyl-1-prop-1-en-2-yl-2,3,9,9a-tetrahydro-1H-cyclopenta[b]chromene-5,8-dione
| Internal ID | d05bd12b-7131-4d3a-8f63-edf472b2c6f2 |
| Taxonomy | Organic acids and derivatives > Vinylogous esters |
| IUPAC Name | (1R,3aR,9aS)-7-methoxy-3a-methyl-1-prop-1-en-2-yl-2,3,9,9a-tetrahydro-1H-cyclopenta[b]chromene-5,8-dione |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C17H20O4/c1-9(2)10-5-6-17(3)12(10)7-11-15(19)14(20-4)8-13(18)16(11)21-17/h8,10,12H,1,5-7H2,2-4H3/t10-,12-,17+/m0/s1 |
| InChI Key | WNIGNVBDYKSWRH-QAGHZCBJSA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C17H20O4 |
| Molecular Weight | 288.34 g/mol |
| Exact Mass | 288.13615911 g/mol |
| Topological Polar Surface Area (TPSA) | 52.60 Ų |
| XlogP | 3.00 |
| There are no found synonyms. |
![2D Structure of (1R,3aR,9aS)-7-methoxy-3a-methyl-1-prop-1-en-2-yl-2,3,9,9a-tetrahydro-1H-cyclopenta[b]chromene-5,8-dione](https://plantaedb.com/storage/docs/compounds/2023/11/2484e1b0-86ef-11ee-ad63-dfb4c52e109c.jpg "2D Structure of (1R,3aR,9aS)-7-methoxy-3a-methyl-1-prop-1-en-2-yl-2,3,9,9a-tetrahydro-1H-cyclopenta[b]chromene-5,8-dione")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.49% | 91.11% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 94.79% | 94.45% |
| CHEMBL1871 | P10275 | Androgen Receptor | 91.08% | 96.43% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 90.54% | 96.09% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.34% | 95.56% |
| CHEMBL2581 | P07339 | Cathepsin D | 89.87% | 98.95% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.45% | 86.33% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 87.45% | 97.14% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 86.09% | 100.00% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 85.73% | 89.00% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 85.36% | 85.14% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 85.11% | 99.23% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 85.00% | 92.94% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 83.27% | 97.25% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.09% | 95.89% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 80.49% | 94.00% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 80.41% | 96.95% |
| CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 80.26% | 97.33% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 80.08% | 97.09% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 162863817 |
| LOTUS | LTS0085809 |
| wikiData | Q105309096 |