2,4,7a-trihydroxy-5-methoxy-1,8,8,9-tetramethyl-9H-phenaleno[3,2-b]furan-3,7-dione
| Internal ID | 5735ccc4-e8fe-41fb-a2e0-7aa9f2fd3de8 |
| Taxonomy | Organoheterocyclic compounds > Naphthofurans |
| IUPAC Name | 2,4,7a-trihydroxy-5-methoxy-1,8,8,9-tetramethyl-9H-phenaleno[3,2-b]furan-3,7-dione |
| SMILES (Canonical) | CC1C(C2(C(=C3C(=C(C(=O)C4=C3C(=CC(=C4O)OC)C2=O)O)C)O1)O)(C)C |
| SMILES (Isomeric) | CC1C(C2(C(=C3C(=C(C(=O)C4=C3C(=CC(=C4O)OC)C2=O)O)C)O1)O)(C)C |
| InChI | InChI=1S/C20H20O7/c1-7-11-12-9(6-10(26-5)15(22)13(12)16(23)14(7)21)17(24)20(25)18(11)27-8(2)19(20,3)4/h6,8,21-22,25H,1-5H3 |
| InChI Key | PQICYTPGRSKLQC-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C20H20O7 |
| Molecular Weight | 372.40 g/mol |
| Exact Mass | 372.12090297 g/mol |
| Topological Polar Surface Area (TPSA) | 113.00 Ų |
| XlogP | 2.00 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.52% | 91.11% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 96.35% | 85.14% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.96% | 95.56% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 90.70% | 89.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.37% | 86.33% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 89.39% | 92.94% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 88.98% | 94.00% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 88.34% | 99.23% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 85.02% | 97.14% |
| CHEMBL2581 | P07339 | Cathepsin D | 84.85% | 98.95% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 82.25% | 83.82% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 82.12% | 99.15% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 81.80% | 90.00% |
| CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 81.63% | 94.42% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 163063581 |
| LOTUS | LTS0110519 |
| wikiData | Q104195216 |