2',4',7-Trihydroxy-flavanone
Internal ID | bc9187f2-b6a9-4b28-b242-1e651fd71a4c |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavans > Flavanones |
IUPAC Name | 2-(2,4-dihydroxyphenyl)-7-hydroxy-2,3-dihydrochromen-4-one |
SMILES (Canonical) | C1C(OC2=C(C1=O)C=CC(=C2)O)C3=C(C=C(C=C3)O)O |
SMILES (Isomeric) | C1C(OC2=C(C1=O)C=CC(=C2)O)C3=C(C=C(C=C3)O)O |
InChI | InChI=1S/C15H12O5/c16-8-1-3-10(12(18)5-8)15-7-13(19)11-4-2-9(17)6-14(11)20-15/h1-6,15-18H,7H2 |
InChI Key | JBQATDIMBVLPRB-UHFFFAOYSA-N |
Popularity | 5 references in papers |
Molecular Formula | C15H12O5 |
Molecular Weight | 272.25 g/mol |
Exact Mass | 272.06847348 g/mol |
Topological Polar Surface Area (TPSA) | 87.00 Ų |
XlogP | 1.80 |
2',4',7-trihydroxy-flavanone |
BDBM50083070 |
![2D Structure of 2',4',7-Trihydroxy-flavanone 2D Structure of 2',4',7-Trihydroxy-flavanone](https://plantaedb.com/storage/docs/compounds/2023/11/247-trihydroxy-flavanone.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.36% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 95.74% | 98.95% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 91.89% | 93.40% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.89% | 95.56% |
CHEMBL217 | P14416 | Dopamine D2 receptor | 90.41% | 95.62% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 89.57% | 89.00% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 89.21% | 90.71% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 88.65% | 96.09% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 86.92% | 99.15% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 86.29% | 99.23% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.66% | 86.33% |
CHEMBL1929 | P47989 | Xanthine dehydrogenase | 83.52% | 96.12% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.28% | 95.89% |
CHEMBL236 | P41143 | Delta opioid receptor | 82.49% | 99.35% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 81.69% | 97.09% |
CHEMBL2535 | P11166 | Glucose transporter | 81.56% | 98.75% |
CHEMBL5852 | Q96P65 | Pyroglutamylated RFamide peptide receptor | 81.23% | 85.00% |
CHEMBL3194 | P02766 | Transthyretin | 81.03% | 90.71% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 80.52% | 100.00% |
CHEMBL5966 | P55899 | IgG receptor FcRn large subunit p51 | 80.28% | 90.93% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Morus alba |
Morus cathayana |
Vachellia vernicosa |
PubChem | 91557562 |
LOTUS | LTS0211311 |
wikiData | Q105124493 |