2,4,6-Trimethyldeca-2,4-dienamide
| Internal ID | a1f8bef4-a8b7-4e27-ae86-102f2ea0af86 |
| Taxonomy | Organic acids and derivatives > Carboximidic acids and derivatives > Carboximidic acids |
| IUPAC Name | 2,4,6-trimethyldeca-2,4-dienamide |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C13H23NO/c1-5-6-7-10(2)8-11(3)9-12(4)13(14)15/h8-10H,5-7H2,1-4H3,(H2,14,15) |
| InChI Key | YVWNECBAHBJBSI-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C13H23NO |
| Molecular Weight | 209.33 g/mol |
| Exact Mass | 209.177964357 g/mol |
| Topological Polar Surface Area (TPSA) | 43.10 Ų |
| XlogP | 4.00 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.64% | 96.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 95.18% | 98.95% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 92.67% | 99.17% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 92.00% | 97.29% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 90.97% | 94.45% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 90.67% | 90.17% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 89.69% | 96.95% |
| CHEMBL2885 | P07451 | Carbonic anhydrase III | 88.76% | 87.45% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 88.75% | 93.56% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 88.24% | 100.00% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 87.45% | 97.21% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 86.70% | 89.63% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 84.72% | 93.31% |
| CHEMBL5043 | Q6P179 | Endoplasmic reticulum aminopeptidase 2 | 84.50% | 91.81% |
| CHEMBL236 | P41143 | Delta opioid receptor | 82.80% | 99.35% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 82.73% | 90.71% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 82.70% | 100.00% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 82.40% | 91.11% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 81.54% | 100.00% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 80.98% | 100.00% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 80.95% | 91.19% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 80.59% | 94.73% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 85280069 |
| LOTUS | LTS0193258 |
| wikiData | Q104202137 |