2,4,6-Trimethoxyphenyl acetate
Internal ID | d32e729d-2e9f-4276-98c8-e9495e68dbda |
Taxonomy | Benzenoids > Phenol esters |
IUPAC Name | (2,4,6-trimethoxyphenyl) acetate |
SMILES (Canonical) | CC(=O)OC1=C(C=C(C=C1OC)OC)OC |
SMILES (Isomeric) | CC(=O)OC1=C(C=C(C=C1OC)OC)OC |
InChI | InChI=1S/C11H14O5/c1-7(12)16-11-9(14-3)5-8(13-2)6-10(11)15-4/h5-6H,1-4H3 |
InChI Key | LQLIWGLJAHTMMY-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C11H14O5 |
Molecular Weight | 226.23 g/mol |
Exact Mass | 226.08412354 g/mol |
Topological Polar Surface Area (TPSA) | 54.00 Ų |
XlogP | 1.60 |
SCHEMBL3326825 |
CHEBI:174166 |
(2,4,6-trimethoxyphenyl) acetate |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.89% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 88.65% | 91.11% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 88.49% | 99.17% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 86.36% | 85.14% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.18% | 95.56% |
CHEMBL4208 | P20618 | Proteasome component C5 | 85.87% | 90.00% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 83.38% | 94.00% |
CHEMBL2535 | P11166 | Glucose transporter | 82.84% | 98.75% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 82.71% | 86.33% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 81.34% | 95.50% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 81.24% | 96.00% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 80.39% | 94.45% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Eucalyptus globulus |
PubChem | 68597137 |
LOTUS | LTS0267203 |
wikiData | Q105155603 |