[(1S,2S,4S,5R,6R,7R,8S,9R,12R)-12-acetyloxy-5,7-dibenzoyloxy-2,8-dihydroxy-2,6,10,10-tetramethyl-11-oxatricyclo[7.2.1.01,6]dodecan-4-yl] benzoate
| Internal ID | 312137ac-e6dd-4b4f-9a98-21a364d0a0e5 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Sesquiterpenoids > Agarofurans |
| IUPAC Name | [(1S,2S,4S,5R,6R,7R,8S,9R,12R)-12-acetyloxy-5,7-dibenzoyloxy-2,8-dihydroxy-2,6,10,10-tetramethyl-11-oxatricyclo[7.2.1.01,6]dodecan-4-yl] benzoate |
| SMILES (Canonical) | CC(=O)OC1C2C(C(C3(C1(C(CC(C3OC(=O)C4=CC=CC=C4)OC(=O)C5=CC=CC=C5)(C)O)OC2(C)C)C)OC(=O)C6=CC=CC=C6)O |
| SMILES (Isomeric) | CC(=O)O[C@@H]1[C@H]2[C@@H]([C@@H]([C@]3([C@]1([C@@](C[C@@H]([C@@H]3OC(=O)C4=CC=CC=C4)OC(=O)C5=CC=CC=C5)(C)O)OC2(C)C)C)OC(=O)C6=CC=CC=C6)O |
| InChI | InChI=1S/C38H40O11/c1-22(39)45-30-27-28(40)31(48-34(43)25-19-13-8-14-20-25)37(5)29(47-33(42)24-17-11-7-12-18-24)26(46-32(41)23-15-9-6-10-16-23)21-36(4,44)38(30,37)49-35(27,2)3/h6-20,26-31,40,44H,21H2,1-5H3/t26-,27+,28-,29-,30+,31-,36-,37-,38-/m0/s1 |
| InChI Key | GCEVIODPDGBRSE-IJNWZCDNSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C38H40O11 |
| Molecular Weight | 672.70 g/mol |
| Exact Mass | 672.25706209 g/mol |
| Topological Polar Surface Area (TPSA) | 155.00 Ų |
| XlogP | 4.90 |
| CHEMBL2373411 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.00% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.51% | 91.11% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 95.05% | 90.17% |
| CHEMBL2581 | P07339 | Cathepsin D | 94.96% | 98.95% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 94.10% | 86.33% |
| CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 89.44% | 94.62% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 89.39% | 99.23% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.12% | 95.56% |
| CHEMBL1293277 | O15118 | Niemann-Pick C1 protein | 87.01% | 81.11% |
| CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 86.47% | 94.08% |
| CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 86.16% | 83.00% |
| CHEMBL2535 | P11166 | Glucose transporter | 84.21% | 98.75% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 84.03% | 97.79% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.75% | 95.89% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 83.75% | 97.14% |
| CHEMBL5028 | O14672 | ADAM10 | 82.92% | 97.50% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 81.88% | 91.49% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 81.47% | 95.50% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 80.10% | 91.19% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Zinowiewia integerrima |
| PubChem | 11787230 |
| LOTUS | LTS0221263 |
| wikiData | Q105006252 |