2,3-Dihydroxy-14-(hydroxymethyl)-5,9-dimethyl-14-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxytetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxylic acid
Internal ID | b814d21b-17d9-411e-a7ad-22ac1d571706 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene glycosides > Diterpene glycosides |
IUPAC Name | 2,3-dihydroxy-14-(hydroxymethyl)-5,9-dimethyl-14-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxytetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxylic acid |
SMILES (Canonical) | CC12CCCC(C1C(C(C34C2CCC(C3)C(C4)(CO)OC5C(C(C(C(O5)CO)O)O)O)O)O)(C)C(=O)O |
SMILES (Isomeric) | CC12CCCC(C1C(C(C34C2CCC(C3)C(C4)(CO)OC5C(C(C(C(O5)CO)O)O)O)O)O)(C)C(=O)O |
InChI | InChI=1S/C26H42O11/c1-23-6-3-7-24(2,22(34)35)19(23)18(32)20(33)25-8-12(4-5-14(23)25)26(10-25,11-28)37-21-17(31)16(30)15(29)13(9-27)36-21/h12-21,27-33H,3-11H2,1-2H3,(H,34,35) |
InChI Key | QUCGBWQRLWOVBR-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C26H42O11 |
Molecular Weight | 530.60 g/mol |
Exact Mass | 530.27271215 g/mol |
Topological Polar Surface Area (TPSA) | 197.00 Ų |
XlogP | -0.50 |
2,3-Dihydroxy-14-(hydroxymethyl)-5,9-dimethyl-14-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxytetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxylic acid |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.44% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.89% | 96.09% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.48% | 97.09% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 90.88% | 90.17% |
CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 88.00% | 96.38% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 87.14% | 92.50% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 87.05% | 95.50% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.10% | 95.89% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 83.65% | 96.21% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 82.98% | 94.45% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 82.45% | 92.62% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 82.36% | 95.56% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 82.07% | 89.00% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 81.59% | 94.33% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 81.26% | 95.83% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 80.85% | 100.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 80.01% | 86.33% |
CHEMBL237 | P41145 | Kappa opioid receptor | 80.00% | 98.10% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Ipomoea nil |
PubChem | 56677731 |
LOTUS | LTS0114771 |
wikiData | Q105228071 |