2,4-Dimethylanisole
| Internal ID | 8823f529-6b31-4124-8fa7-1b27d471a94b |
| Taxonomy | Benzenoids > Phenol ethers > Anisoles |
| IUPAC Name | 1-methoxy-2,4-dimethylbenzene |
| SMILES (Canonical) | CC1=CC(=C(C=C1)OC)C |
| SMILES (Isomeric) | CC1=CC(=C(C=C1)OC)C |
| InChI | InChI=1S/C9H12O/c1-7-4-5-9(10-3)8(2)6-7/h4-6H,1-3H3 |
| InChI Key | UJCFZCTTZWHRNL-UHFFFAOYSA-N |
| Popularity | 21 references in papers |
| Molecular Formula | C9H12O |
| Molecular Weight | 136.19 g/mol |
| Exact Mass | 136.088815002 g/mol |
| Topological Polar Surface Area (TPSA) | 9.20 Ų |
| XlogP | 3.10 |
| 6738-23-4 |
| 1-Methoxy-2,4-dimethylbenzene |
| Benzene, 1-methoxy-2,4-dimethyl- |
| 4-METHOXY-M-XYLENE |
| UNII-5V1B5L4GK6 |
| 5V1B5L4GK6 |
| EINECS 229-794-9 |
| NSC-137834 |
| AI3-21151 |
| FEMA NO. 3828 |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.47% | 95.56% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 88.29% | 89.62% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 87.19% | 96.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.94% | 86.33% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 84.72% | 94.00% |
| CHEMBL1913 | P09619 | Platelet-derived growth factor receptor beta | 84.72% | 95.70% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 83.27% | 96.09% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 81.28% | 85.14% |
| CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 80.17% | 97.36% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Elsholtzia ciliata |
| Mosla chinensis |