2,4-Dimethyl-1H-indole
| Internal ID | 8e25cbee-6145-433d-bbbd-7ede1110e334 |
| Taxonomy | Organoheterocyclic compounds > Indoles and derivatives > Indoles |
| IUPAC Name | 2,4-dimethyl-1H-indole |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C10H11N/c1-7-4-3-5-10-9(7)6-8(2)11-10/h3-6,11H,1-2H3 |
| InChI Key | YBUMNVFXMLIKDZ-UHFFFAOYSA-N |
| Popularity | 4 references in papers |
| Molecular Formula | C10H11N |
| Molecular Weight | 145.20 g/mol |
| Exact Mass | 145.089149355 g/mol |
| Topological Polar Surface Area (TPSA) | 15.80 Ų |
| XlogP | 2.80 |
| 10299-61-3 |
| 2,4-dimethylindole |
| 2,4 dimethyl indole |
| SCHEMBL8230643 |
| DTXSID70451166 |
| CHEBI:169202 |
| MFCD09701270 |
| AKOS006331463 |
| SB30276 |
| CS-0342291 |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.76% | 95.56% |
| CHEMBL2581 | P07339 | Cathepsin D | 91.26% | 98.95% |
| CHEMBL3227 | P41594 | Metabotropic glutamate receptor 5 | 90.22% | 96.42% |
| CHEMBL1913 | P09619 | Platelet-derived growth factor receptor beta | 88.95% | 95.70% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 87.46% | 94.73% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 86.51% | 91.11% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 86.40% | 93.31% |
| CHEMBL4302 | P08183 | P-glycoprotein 1 | 85.93% | 92.98% |
| CHEMBL1907594 | P30926 | Neuronal acetylcholine receptor; alpha3/beta4 | 85.81% | 97.23% |
| CHEMBL2535 | P11166 | Glucose transporter | 85.15% | 98.75% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 84.00% | 93.99% |
| CHEMBL1936 | P10721 | Stem cell growth factor receptor | 83.44% | 84.17% |
| CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 82.61% | 93.65% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 82.11% | 94.45% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 10997169 |
| LOTUS | LTS0080352 |
| wikiData | Q75055070 |