2,4-Dimethoxy-1-(3-methylbut-2-enyl)dibenzofuran-3,7-diol
| Internal ID | c72b00dd-568b-4512-b47f-772201a2e861 |
| Taxonomy | Organoheterocyclic compounds > Benzofurans > Dibenzofurans |
| IUPAC Name | 2,4-dimethoxy-1-(3-methylbut-2-enyl)dibenzofuran-3,7-diol |
| SMILES (Canonical) | CC(=CCC1=C2C3=C(C=C(C=C3)O)OC2=C(C(=C1OC)O)OC)C |
| SMILES (Isomeric) | CC(=CCC1=C2C3=C(C=C(C=C3)O)OC2=C(C(=C1OC)O)OC)C |
| InChI | InChI=1S/C19H20O5/c1-10(2)5-7-13-15-12-8-6-11(20)9-14(12)24-18(15)19(23-4)16(21)17(13)22-3/h5-6,8-9,20-21H,7H2,1-4H3 |
| InChI Key | FNNLVGVZMHDVRW-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C19H20O5 |
| Molecular Weight | 328.40 g/mol |
| Exact Mass | 328.13107373 g/mol |
| Topological Polar Surface Area (TPSA) | 72.10 Ų |
| XlogP | 4.80 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.69% | 91.11% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 98.27% | 94.45% |
| CHEMBL1163101 | O75460 | Serine/threonine-protein kinase/endoribonuclease IRE1 | 94.37% | 98.11% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 91.85% | 94.73% |
| CHEMBL2581 | P07339 | Cathepsin D | 90.13% | 98.95% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.75% | 86.33% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 89.51% | 99.17% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 89.15% | 89.00% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 88.66% | 94.00% |
| CHEMBL242 | Q92731 | Estrogen receptor beta | 87.72% | 98.35% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 86.66% | 89.62% |
| CHEMBL1293255 | P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD+] | 86.07% | 83.57% |
| CHEMBL3286 | P00749 | Urokinase-type plasminogen activator | 86.02% | 97.88% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 85.37% | 91.49% |
| CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 84.99% | 91.71% |
| CHEMBL3194 | P02766 | Transthyretin | 83.25% | 90.71% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 82.09% | 95.56% |
| CHEMBL4306 | P22460 | Voltage-gated potassium channel subunit Kv1.5 | 80.32% | 94.03% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Calophyllum pauciflorum |
| PubChem | 101688433 |
| LOTUS | LTS0110960 |
| wikiData | Q104998393 |