2',4'-Dihydroxy-3,4-dimethoxychalcone
| Internal ID | c2086ec0-5507-4374-9ac1-680d83027a70 |
| Taxonomy | Phenylpropanoids and polyketides > Linear 1,3-diarylpropanoids > Chalcones and dihydrochalcones > 2-Hydroxychalcones |
| IUPAC Name | (E)-1-(2,4-dihydroxyphenyl)-3-(3,4-dimethoxyphenyl)prop-2-en-1-one |
| SMILES (Canonical) | COC1=C(C=C(C=C1)C=CC(=O)C2=C(C=C(C=C2)O)O)OC |
| SMILES (Isomeric) | COC1=C(C=C(C=C1)/C=C/C(=O)C2=C(C=C(C=C2)O)O)OC |
| InChI | InChI=1S/C17H16O5/c1-21-16-8-4-11(9-17(16)22-2)3-7-14(19)13-6-5-12(18)10-15(13)20/h3-10,18,20H,1-2H3/b7-3+ |
| InChI Key | ZMMIEHPFMMRMMN-XVNBXDOJSA-N |
| Popularity | 6 references in papers |
| Molecular Formula | C17H16O5 |
| Molecular Weight | 300.30 g/mol |
| Exact Mass | 300.09977361 g/mol |
| Topological Polar Surface Area (TPSA) | 76.00 Ų |
| XlogP | 3.50 |
| 4315-88-2 |
| CHEMBL573524 |
| (E)-1-(2,4-dihydroxyphenyl)-3-(3,4-dimethoxyphenyl)prop-2-en-1-one |
| 2-Propen-1-one, 1-(2,4-dihydroxyphenyl)-3-(3,4-dimethoxyphenyl)- |
| Chalcone, 2',4'-dihydroxy-3,4-dimethoxy- |
| SCHEMBL633469 |
| SPECTRUM1505148 |
| Acrylophenone, 2',4'-dihydroxy-3-(3,4-dimethoxyphenyl)- |
| ZMMIEHPFMMRMMN-XVNBXDOJSA-N |
| 1-(2,4-Dihydroxyphenyl)-3-(3,4-dimethoxyphenyl)-2-propen-1-one |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| CHEMBL5393 | Q9UNQ0 | ATP-binding cassette sub-family G member 2 |
850 nM |
IC50 |
via Super-PRED
|
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3194 | P02766 | Transthyretin | 95.79% | 90.71% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 95.20% | 86.33% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.13% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.94% | 96.09% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.77% | 95.56% |
| CHEMBL2535 | P11166 | Glucose transporter | 91.74% | 98.75% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 88.88% | 90.00% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 88.50% | 96.00% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 88.33% | 95.50% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 86.95% | 99.17% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 86.77% | 90.20% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 84.31% | 89.62% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.22% | 89.00% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 84.00% | 92.94% |
| CHEMBL2581 | P07339 | Cathepsin D | 83.49% | 98.95% |
| CHEMBL1929 | P47989 | Xanthine dehydrogenase | 83.01% | 96.12% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 80.81% | 94.45% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Astragalus laxmannii |
| Iryanthera polyneura |
| PubChem | 5953849 |
| LOTUS | LTS0207553 |
| wikiData | Q76313539 |