2,4-Dihydroxy-3-methyl-6-[(2-methyl-2,3-dihydropyran-6-ylidene)methyl]benzaldehyde
| Internal ID | 971f6b3f-9097-4ec2-9554-d74c1b539024 |
| Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbonyl compounds > Benzaldehydes > Hydroxybenzaldehydes |
| IUPAC Name | 2,4-dihydroxy-3-methyl-6-[(2-methyl-2,3-dihydropyran-6-ylidene)methyl]benzaldehyde |
| SMILES (Canonical) | CC1CC=CC(=CC2=CC(=C(C(=C2C=O)O)C)O)O1 |
| SMILES (Isomeric) | CC1CC=CC(=CC2=CC(=C(C(=C2C=O)O)C)O)O1 |
| InChI | InChI=1S/C15H16O4/c1-9-4-3-5-12(19-9)6-11-7-14(17)10(2)15(18)13(11)8-16/h3,5-9,17-18H,4H2,1-2H3 |
| InChI Key | YUNYOSJRYNLHEN-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C15H16O4 |
| Molecular Weight | 260.28 g/mol |
| Exact Mass | 260.10485899 g/mol |
| Topological Polar Surface Area (TPSA) | 66.80 Ų |
| XlogP | 3.30 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL1163101 | O75460 | Serine/threonine-protein kinase/endoribonuclease IRE1 | 98.40% | 98.11% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 96.45% | 95.56% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 94.59% | 91.49% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 92.18% | 91.11% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 91.58% | 89.00% |
| CHEMBL1293255 | P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD+] | 88.82% | 83.57% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 86.98% | 94.73% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 85.24% | 100.00% |
| CHEMBL2964 | P36507 | Dual specificity mitogen-activated protein kinase kinase 2 | 83.18% | 80.00% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 82.18% | 90.71% |
| CHEMBL4530 | P00488 | Coagulation factor XIII | 82.08% | 96.00% |
| CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 82.08% | 98.75% |
| CHEMBL4803 | P29474 | Nitric-oxide synthase, endothelial | 81.99% | 86.00% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 81.75% | 93.40% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 81.21% | 91.07% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 80.58% | 92.94% |
| CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 80.41% | 94.80% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 80.10% | 99.23% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 163060375 |
| LOTUS | LTS0194620 |
| wikiData | Q104202106 |