2,4-Decadienoic acid piperidide
| Internal ID | dfb72c10-0672-4582-8598-55382f9fbbce |
| Taxonomy | Organoheterocyclic compounds > Piperidines > N-acylpiperidines |
| IUPAC Name | 1-piperidin-1-yldeca-2,4-dien-1-one |
| SMILES (Canonical) | CCCCCC=CC=CC(=O)N1CCCCC1 |
| SMILES (Isomeric) | CCCCCC=CC=CC(=O)N1CCCCC1 |
| InChI | InChI=1S/C15H25NO/c1-2-3-4-5-6-7-9-12-15(17)16-13-10-8-11-14-16/h6-7,9,12H,2-5,8,10-11,13-14H2,1H3 |
| InChI Key | ZPSGREUUQGTKDE-UHFFFAOYSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C15H25NO |
| Molecular Weight | 235.36 g/mol |
| Exact Mass | 235.193614421 g/mol |
| Topological Polar Surface Area (TPSA) | 20.30 Ų |
| XlogP | 4.10 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 98.08% | 89.63% |
| CHEMBL2581 | P07339 | Cathepsin D | 96.09% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.61% | 96.09% |
| CHEMBL5043 | Q6P179 | Endoplasmic reticulum aminopeptidase 2 | 93.02% | 91.81% |
| CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 89.73% | 92.86% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 87.29% | 100.00% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 87.27% | 99.17% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 84.98% | 95.50% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 82.70% | 94.33% |
| CHEMBL3105 | P09874 | Poly [ADP-ribose] polymerase-1 | 81.60% | 93.90% |
| CHEMBL1781 | P11387 | DNA topoisomerase I | 81.20% | 97.00% |
| CHEMBL2781 | P19634 | Sodium/hydrogen exchanger 1 | 81.01% | 90.24% |
| CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 80.52% | 92.08% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 80.26% | 93.56% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Achillea falcata |
| Achillea millefolium |
| Artemisia dracunculus |
| Piper nigrum |
| Piper tuberculatum |
| PubChem | 73816694 |
| LOTUS | LTS0110933 |
| wikiData | Q105381158 |