2,4-Bis[(4-hydroxyphenyl)methyl]-5-methoxy-3-(2-phenylethyl)phenol
| Internal ID | 0aa5fa35-96de-4802-a3be-1e7c0e0dd414 |
| Taxonomy | Phenylpropanoids and polyketides > Diarylheptanoids > Linear diarylheptanoids > Curcuminoids |
| IUPAC Name | 2,4-bis[(4-hydroxyphenyl)methyl]-5-methoxy-3-(2-phenylethyl)phenol |
| SMILES (Canonical) | COC1=C(C(=C(C(=C1)O)CC2=CC=C(C=C2)O)CCC3=CC=CC=C3)CC4=CC=C(C=C4)O |
| SMILES (Isomeric) | COC1=C(C(=C(C(=C1)O)CC2=CC=C(C=C2)O)CCC3=CC=CC=C3)CC4=CC=C(C=C4)O |
| InChI | InChI=1S/C29H28O4/c1-33-29-19-28(32)26(17-21-7-12-23(30)13-8-21)25(16-11-20-5-3-2-4-6-20)27(29)18-22-9-14-24(31)15-10-22/h2-10,12-15,19,30-32H,11,16-18H2,1H3 |
| InChI Key | GZSKXXXVAHIJGD-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C29H28O4 |
| Molecular Weight | 440.50 g/mol |
| Exact Mass | 440.19875937 g/mol |
| Topological Polar Surface Area (TPSA) | 69.90 Ų |
| XlogP | 6.90 |
| There are no found synonyms. |
![2D Structure of 2,4-Bis[(4-hydroxyphenyl)methyl]-5-methoxy-3-(2-phenylethyl)phenol](https://plantaedb.com/storage/docs/compounds/2023/11/24-bis4-hydroxyphenylmethyl-5-methoxy-3-2-phenylethylphenol.jpg "2D Structure of 2,4-Bis[(4-hydroxyphenyl)methyl]-5-methoxy-3-(2-phenylethyl)phenol")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 96.44% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.28% | 96.09% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 94.08% | 86.33% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 93.71% | 90.20% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 93.61% | 95.50% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.51% | 91.11% |
| CHEMBL2535 | P11166 | Glucose transporter | 92.05% | 98.75% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 91.93% | 99.17% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.00% | 95.56% |
| CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 88.24% | 95.17% |
| CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 85.96% | 94.62% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 84.06% | 90.00% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 83.83% | 94.00% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 83.34% | 96.95% |
| CHEMBL5939 | Q9NZ08 | Endoplasmic reticulum aminopeptidase 1 | 83.20% | 100.00% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 82.50% | 93.99% |
| CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 81.54% | 91.71% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 80.11% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Arundina graminifolia |
| Pleione formosana |
| PubChem | 85687787 |
| LOTUS | LTS0153508 |
| wikiData | Q105279346 |