2,4-bis[(1R)-1-phenylethyl]phenol
Internal ID | f40c9ab3-2896-47ab-bab9-e16f329e3b83 |
Taxonomy | Phenylpropanoids and polyketides > Diarylheptanoids > Linear diarylheptanoids |
IUPAC Name | 2,4-bis[(1R)-1-phenylethyl]phenol |
SMILES (Canonical) | CC(C1=CC=CC=C1)C2=CC(=C(C=C2)O)C(C)C3=CC=CC=C3 |
SMILES (Isomeric) | C[C@H](C1=CC=CC=C1)C2=CC(=C(C=C2)O)[C@H](C)C3=CC=CC=C3 |
InChI | InChI=1S/C22H22O/c1-16(18-9-5-3-6-10-18)20-13-14-22(23)21(15-20)17(2)19-11-7-4-8-12-19/h3-17,23H,1-2H3/t16-,17-/m1/s1 |
InChI Key | RCFAHSGZAAFQJH-IAGOWNOFSA-N |
Popularity | 0 references in papers |
Molecular Formula | C22H22O |
Molecular Weight | 302.40 g/mol |
Exact Mass | 302.167065321 g/mol |
Topological Polar Surface Area (TPSA) | 20.20 Ų |
XlogP | 6.10 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.17% | 91.11% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 95.07% | 99.15% |
CHEMBL2581 | P07339 | Cathepsin D | 94.37% | 98.95% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.49% | 95.56% |
CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 89.16% | 94.62% |
CHEMBL4040 | P28482 | MAP kinase ERK2 | 87.66% | 83.82% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 86.23% | 91.49% |
CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 85.65% | 94.08% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.30% | 86.33% |
CHEMBL4208 | P20618 | Proteasome component C5 | 83.03% | 90.00% |
CHEMBL3401 | O75469 | Pregnane X receptor | 82.99% | 94.73% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 82.50% | 96.09% |
CHEMBL2535 | P11166 | Glucose transporter | 80.20% | 98.75% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Zanthoxylum integrifoliolum |
PubChem | 92288053 |
LOTUS | LTS0189020 |
wikiData | Q105233604 |