2,3,9,10-tetramethoxy-6,8-dihydro-5H-isoquinolino[2,1-b]isoquinolin-8-ol
| Internal ID | ceb747e0-720f-4a6d-9d49-da7b61d0082f |
| Taxonomy | Alkaloids and derivatives > Protoberberine alkaloids and derivatives |
| IUPAC Name | 2,3,9,10-tetramethoxy-6,8-dihydro-5H-isoquinolino[2,1-b]isoquinolin-8-ol |
| SMILES (Canonical) | COC1=C(C2=C(C=C1)C=C3C4=CC(=C(C=C4CCN3C2O)OC)OC)OC |
| SMILES (Isomeric) | COC1=C(C2=C(C=C1)C=C3C4=CC(=C(C=C4CCN3C2O)OC)OC)OC |
| InChI | InChI=1S/C21H23NO5/c1-24-16-6-5-13-9-15-14-11-18(26-3)17(25-2)10-12(14)7-8-22(15)21(23)19(13)20(16)27-4/h5-6,9-11,21,23H,7-8H2,1-4H3 |
| InChI Key | XQCLUPWMBVLJKO-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C21H23NO5 |
| Molecular Weight | 369.40 g/mol |
| Exact Mass | 369.15762283 g/mol |
| Topological Polar Surface Area (TPSA) | 60.40 Ų |
| XlogP | 3.10 |
| 2,3,9,10-tetramethoxy-6,8-dihydro-5H-isoquinolino[2,1-b]isoquinolin-8-ol |
![2D Structure of 2,3,9,10-tetramethoxy-6,8-dihydro-5H-isoquinolino[2,1-b]isoquinolin-8-ol](https://plantaedb.com/storage/docs/compounds/2023/11/23910-tetramethoxy-68-dihydro-5h-isoquinolino21-bisoquinolin-8-ol.jpg "2D Structure of 2,3,9,10-tetramethoxy-6,8-dihydro-5H-isoquinolino[2,1-b]isoquinolin-8-ol")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.87% | 96.09% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 96.47% | 91.49% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 95.54% | 92.94% |
| CHEMBL2581 | P07339 | Cathepsin D | 92.77% | 98.95% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 92.62% | 89.62% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.42% | 86.33% |
| CHEMBL5747 | Q92793 | CREB-binding protein | 90.47% | 95.12% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 90.08% | 95.89% |
| CHEMBL2535 | P11166 | Glucose transporter | 87.90% | 98.75% |
| CHEMBL2056 | P21728 | Dopamine D1 receptor | 87.20% | 91.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.78% | 95.56% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 84.02% | 90.00% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 83.80% | 94.00% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 83.13% | 85.14% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 82.09% | 95.89% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 81.21% | 93.99% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 80.67% | 89.00% |
| CHEMBL3474 | P14555 | Phospholipase A2 group IIA | 80.59% | 94.05% |
| CHEMBL3746 | P80365 | 11-beta-hydroxysteroid dehydrogenase 2 | 80.53% | 94.78% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Annickia chlorantha |
| PubChem | 493569 |
| LOTUS | LTS0133842 |
| wikiData | Q105339614 |