2,3,9-Trihydroxyphenazine-1-carboxylic acid
| Internal ID | 972cedd3-da0e-4d6a-bb46-67068be19292 |
| Taxonomy | Organoheterocyclic compounds > Diazanaphthalenes > Benzodiazines > Quinoxalines > Phenazines and derivatives |
| IUPAC Name | 2,3,9-trihydroxyphenazine-1-carboxylic acid |
| SMILES (Canonical) | C1=CC2=NC3=CC(=C(C(=C3N=C2C(=C1)O)C(=O)O)O)O |
| SMILES (Isomeric) | C1=CC2=NC3=CC(=C(C(=C3N=C2C(=C1)O)C(=O)O)O)O |
| InChI | InChI=1S/C13H8N2O5/c16-7-3-1-2-5-10(7)15-11-6(14-5)4-8(17)12(18)9(11)13(19)20/h1-4,16-18H,(H,19,20) |
| InChI Key | YRALVZSNGOJWCS-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C13H8N2O5 |
| Molecular Weight | 272.21 g/mol |
| Exact Mass | 272.04332136 g/mol |
| Topological Polar Surface Area (TPSA) | 124.00 Ų |
| XlogP | 1.60 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.61% | 91.11% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 93.29% | 99.15% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.71% | 86.33% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 89.98% | 99.23% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.98% | 95.56% |
| CHEMBL1293255 | P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD+] | 86.82% | 83.57% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 86.15% | 94.75% |
| CHEMBL2581 | P07339 | Cathepsin D | 86.12% | 98.95% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 84.32% | 90.20% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 83.88% | 94.73% |
| CHEMBL1811 | P34995 | Prostanoid EP1 receptor | 83.65% | 95.71% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 82.19% | 96.00% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 81.92% | 95.50% |
| CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 81.15% | 94.62% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 136756816 |
| LOTUS | LTS0121198 |
| wikiData | Q105352686 |