(2S,3S,4S,5R,6R)-6-[(2S,3S,4S,5S,6S)-2-carboxy-5-[(2R,3R,4S,5S,6R)-6-carboxy-4,5-dihydroxy-3-[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]oxyoxan-2-yl]oxy-3-hydroxy-6-[5-hydroxy-2-(4-hydroxyphenyl)-4-oxochromen-7-yl]oxyoxan-4-yl]oxy-3,4,5-trihydroxyoxane-2-carboxylic acid
Internal ID | 1241f6ff-643e-4a8b-bac8-19e816273d74 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glucuronides > Flavonoid-7-O-glucuronides |
IUPAC Name | (2S,3S,4S,5R,6R)-6-[(2S,3S,4S,5S,6S)-2-carboxy-5-[(2R,3R,4S,5S,6R)-6-carboxy-4,5-dihydroxy-3-[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]oxyoxan-2-yl]oxy-3-hydroxy-6-[5-hydroxy-2-(4-hydroxyphenyl)-4-oxochromen-7-yl]oxyoxan-4-yl]oxy-3,4,5-trihydroxyoxane-2-carboxylic acid |
SMILES (Canonical) | C1=CC(=CC=C1C=CC(=O)OC2C(C(C(OC2OC3C(C(C(OC3OC4=CC(=C5C(=C4)OC(=CC5=O)C6=CC=C(C=C6)O)O)C(=O)O)O)OC7C(C(C(C(O7)C(=O)O)O)O)O)C(=O)O)O)O)O |
SMILES (Isomeric) | C1=CC(=CC=C1/C=C/C(=O)O[C@@H]2[C@H]([C@@H]([C@@H](O[C@H]2O[C@H]3[C@H]([C@@H]([C@H](O[C@H]3OC4=CC(=C5C(=C4)OC(=CC5=O)C6=CC=C(C=C6)O)O)C(=O)O)O)O[C@H]7[C@@H]([C@H]([C@@H]([C@H](O7)C(=O)O)O)O)O)C(=O)O)O)O)O |
InChI | InChI=1S/C42H40O25/c43-16-6-1-14(2-7-16)3-10-23(47)62-35-28(51)27(50)33(38(56)57)65-41(35)67-36-31(63-40-29(52)25(48)26(49)32(64-40)37(54)55)30(53)34(39(58)59)66-42(36)60-18-11-19(45)24-20(46)13-21(61-22(24)12-18)15-4-8-17(44)9-5-15/h1-13,25-36,40-45,48-53H,(H,54,55)(H,56,57)(H,58,59)/b10-3+/t25-,26-,27-,28-,29+,30-,31-,32-,33+,34-,35+,36-,40+,41-,42+/m0/s1 |
InChI Key | VEZCNUXSJSUNJZ-GGZGYOFQSA-N |
Popularity | 0 references in papers |
Molecular Formula | C42H40O25 |
Molecular Weight | 944.70 g/mol |
Exact Mass | 944.18586676 g/mol |
Topological Polar Surface Area (TPSA) | 402.00 Ų |
XlogP | 0.70 |
There are no found synonyms. |
![2D Structure of (2S,3S,4S,5R,6R)-6-[(2S,3S,4S,5S,6S)-2-carboxy-5-[(2R,3R,4S,5S,6R)-6-carboxy-4,5-dihydroxy-3-[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]oxyoxan-2-yl]oxy-3-hydroxy-6-[5-hydroxy-2-(4-hydroxyphenyl)-4-oxochromen-7-yl]oxyoxan-4-yl]oxy-3,4,5-trihydroxyoxane-2-carboxylic acid 2D Structure of (2S,3S,4S,5R,6R)-6-[(2S,3S,4S,5S,6S)-2-carboxy-5-[(2R,3R,4S,5S,6R)-6-carboxy-4,5-dihydroxy-3-[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]oxyoxan-2-yl]oxy-3-hydroxy-6-[5-hydroxy-2-(4-hydroxyphenyl)-4-oxochromen-7-yl]oxyoxan-4-yl]oxy-3,4,5-trihydroxyoxane-2-carboxylic acid](https://plantaedb.com/storage/docs/compounds/2023/11/238c14b0-852f-11ee-8c74-999772d0e2bf.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL1951 | P21397 | Monoamine oxidase A | 99.53% | 91.49% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.12% | 91.11% |
CHEMBL3194 | P02766 | Transthyretin | 98.04% | 90.71% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 97.92% | 89.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 95.51% | 86.33% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 92.55% | 99.15% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.12% | 95.56% |
CHEMBL242 | Q92731 | Estrogen receptor beta | 91.10% | 98.35% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 90.74% | 91.71% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 90.51% | 94.45% |
CHEMBL2581 | P07339 | Cathepsin D | 90.36% | 98.95% |
CHEMBL1293255 | P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD+] | 88.76% | 83.57% |
CHEMBL4531 | P17931 | Galectin-3 | 87.99% | 96.90% |
CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 87.66% | 95.78% |
CHEMBL2208 | P49137 | MAP kinase-activated protein kinase 2 | 86.32% | 95.20% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 86.19% | 95.50% |
CHEMBL245 | P20309 | Muscarinic acetylcholine receptor M3 | 85.32% | 97.53% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 84.46% | 99.17% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 84.23% | 90.71% |
CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 84.23% | 95.64% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 83.65% | 94.00% |
CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 83.62% | 94.62% |
CHEMBL3401 | O75469 | Pregnane X receptor | 82.55% | 94.73% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 81.90% | 96.00% |
CHEMBL4530 | P00488 | Coagulation factor XIII | 80.42% | 96.00% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 80.22% | 99.23% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Medicago sativa |
PubChem | 163074648 |
LOTUS | LTS0144745 |
wikiData | Q105284921 |