2,3,8,10-tetramethoxy-6a,12a-dihydro-5H-isochromeno[4,3-b]chromen-7-one
| Internal ID | 42391df0-90d4-4064-8faa-d32bc77f010f |
| Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Pyranoflavonoids |
| IUPAC Name | 2,3,8,10-tetramethoxy-6a,12a-dihydro-5H-isochromeno[4,3-b]chromen-7-one |
| SMILES (Canonical) | COC1=CC2=C(C(=C1)OC)C(=O)C3C(O2)C4=CC(=C(C=C4CO3)OC)OC |
| SMILES (Isomeric) | COC1=CC2=C(C(=C1)OC)C(=O)C3C(O2)C4=CC(=C(C=C4CO3)OC)OC |
| InChI | InChI=1S/C20H20O7/c1-22-11-6-15(25-4)17-16(7-11)27-19-12-8-14(24-3)13(23-2)5-10(12)9-26-20(19)18(17)21/h5-8,19-20H,9H2,1-4H3 |
| InChI Key | IDMPXVKBMCVCBV-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C20H20O7 |
| Molecular Weight | 372.40 g/mol |
| Exact Mass | 372.12090297 g/mol |
| Topological Polar Surface Area (TPSA) | 72.40 Ų |
| XlogP | 2.30 |
| There are no found synonyms. |
![2D Structure of 2,3,8,10-tetramethoxy-6a,12a-dihydro-5H-isochromeno[4,3-b]chromen-7-one](https://plantaedb.com/storage/docs/compounds/2023/11/23810-tetramethoxy-6a12a-dihydro-5h-isochromeno43-bchromen-7-one.jpg "2D Structure of 2,3,8,10-tetramethoxy-6a,12a-dihydro-5H-isochromeno[4,3-b]chromen-7-one")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.36% | 95.56% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.19% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.07% | 91.11% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 92.84% | 93.99% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.43% | 86.33% |
| CHEMBL2535 | P11166 | Glucose transporter | 87.33% | 98.75% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 86.91% | 85.14% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 86.33% | 92.62% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 84.72% | 92.94% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 84.54% | 97.14% |
| CHEMBL2581 | P07339 | Cathepsin D | 83.48% | 98.95% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 83.45% | 94.45% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 83.40% | 93.40% |
| CHEMBL4247 | Q9UM73 | ALK tyrosine kinase receptor | 82.87% | 96.86% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 81.89% | 99.17% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 81.62% | 91.07% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 81.37% | 97.09% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 81.11% | 99.23% |
| CHEMBL5311 | P37023 | Serine/threonine-protein kinase receptor R3 | 80.88% | 82.67% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Acacia carneorum |
| PubChem | 15555868 |
| LOTUS | LTS0048756 |
| wikiData | Q105111420 |