2,3,7-Trimethoxy-9,11,12,13,13a,14-hexahydrophenanthro[10,9-f]indolizin-6-ol
| Internal ID | 5f04d794-2bd2-4476-bbd1-777effe20065 |
| Taxonomy | Benzenoids > Phenanthrenes and derivatives > Phenanthroindolizidines |
| IUPAC Name | 2,3,7-trimethoxy-9,11,12,13,13a,14-hexahydrophenanthro[10,9-f]indolizin-6-ol |
| SMILES (Canonical) | COC1=C(C=C2C(=C1)C3=C(CC4CCCN4C3)C5=CC(=C(C=C25)OC)OC)O |
| SMILES (Isomeric) | COC1=C(C=C2C(=C1)C3=C(CC4CCCN4C3)C5=CC(=C(C=C25)OC)OC)O |
| InChI | InChI=1S/C23H25NO4/c1-26-21-9-18-15(8-20(21)25)17-11-23(28-3)22(27-2)10-16(17)14-7-13-5-4-6-24(13)12-19(14)18/h8-11,13,25H,4-7,12H2,1-3H3 |
| InChI Key | ZWPFWEJMOPUEJE-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C23H25NO4 |
| Molecular Weight | 379.40 g/mol |
| Exact Mass | 379.17835828 g/mol |
| Topological Polar Surface Area (TPSA) | 51.20 Ų |
| XlogP | 4.40 |
| There are no found synonyms. |
![2D Structure of 2,3,7-Trimethoxy-9,11,12,13,13a,14-hexahydrophenanthro[10,9-f]indolizin-6-ol](https://plantaedb.com/storage/docs/compounds/2023/11/237-trimethoxy-911121313a14-hexahydrophenanthro109-findolizin-6-ol.jpg "2D Structure of 2,3,7-Trimethoxy-9,11,12,13,13a,14-hexahydrophenanthro[10,9-f]indolizin-6-ol")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 97.14% | 92.94% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.17% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.23% | 96.09% |
| CHEMBL3438 | Q05513 | Protein kinase C zeta | 93.17% | 88.48% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 92.86% | 95.89% |
| CHEMBL2041 | P07949 | Tyrosine-protein kinase receptor RET | 92.44% | 91.79% |
| CHEMBL2535 | P11166 | Glucose transporter | 92.33% | 98.75% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 92.14% | 89.62% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.50% | 95.56% |
| CHEMBL5203 | P33316 | dUTP pyrophosphatase | 89.83% | 99.18% |
| CHEMBL217 | P14416 | Dopamine D2 receptor | 88.55% | 95.62% |
| CHEMBL5747 | Q92793 | CREB-binding protein | 87.80% | 95.12% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.50% | 86.33% |
| CHEMBL4895 | P30530 | Tyrosine-protein kinase receptor UFO | 84.86% | 90.95% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 84.22% | 94.45% |
| CHEMBL2581 | P07339 | Cathepsin D | 84.05% | 98.95% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 82.83% | 90.00% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 81.53% | 94.00% |
| CHEMBL264 | Q9Y5N1 | Histamine H3 receptor | 81.49% | 91.43% |
| CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 81.34% | 91.03% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 80.30% | 97.09% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 15627985 |
| LOTUS | LTS0137696 |
| wikiData | Q105385116 |