(+/-)-Antofine
| Internal ID | 1db64438-ba08-491a-8992-11af4654b882 |
| Taxonomy | Benzenoids > Phenanthrenes and derivatives > Phenanthroindolizidines |
| IUPAC Name | 2,3,6-trimethoxy-9,11,12,13,13a,14-hexahydrophenanthro[9,10-f]indolizine |
| SMILES (Canonical) | COC1=CC2=C(C=C1)C3=C(CC4CCCN4C3)C5=CC(=C(C=C52)OC)OC |
| SMILES (Isomeric) | COC1=CC2=C(C=C1)C3=C(CC4CCCN4C3)C5=CC(=C(C=C52)OC)OC |
| InChI | InChI=1S/C23H25NO3/c1-25-15-6-7-16-18(10-15)20-12-23(27-3)22(26-2)11-19(20)17-9-14-5-4-8-24(14)13-21(16)17/h6-7,10-12,14H,4-5,8-9,13H2,1-3H3 |
| InChI Key | NCVWJDISIZHFQS-UHFFFAOYSA-N |
| Popularity | 4 references in papers |
| Molecular Formula | C23H25NO3 |
| Molecular Weight | 363.40 g/mol |
| Exact Mass | 363.18344366 g/mol |
| Topological Polar Surface Area (TPSA) | 30.90 Ų |
| XlogP | 4.80 |
| (+/-)-Antofine |
| CHEMBL244969 |
| SCHEMBL13222735 |
| 2,3,6-trimethoxy-9,11,12,13,13a,14-hexahydrophenanthro[9,10-f]indolizine |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3438 | Q05513 | Protein kinase C zeta | 95.36% | 88.48% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 94.90% | 95.89% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 93.98% | 92.94% |
| CHEMBL5203 | P33316 | dUTP pyrophosphatase | 93.96% | 99.18% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.58% | 95.56% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.00% | 96.09% |
| CHEMBL5747 | Q92793 | CREB-binding protein | 92.60% | 95.12% |
| CHEMBL2535 | P11166 | Glucose transporter | 92.53% | 98.75% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 91.76% | 89.62% |
| CHEMBL264 | Q9Y5N1 | Histamine H3 receptor | 90.79% | 91.43% |
| CHEMBL4895 | P30530 | Tyrosine-protein kinase receptor UFO | 89.53% | 90.95% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.23% | 97.09% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 89.00% | 93.31% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 88.96% | 91.11% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 88.70% | 90.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.54% | 86.33% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 87.11% | 93.99% |
| CHEMBL2146302 | O94925 | Glutaminase kidney isoform, mitochondrial | 84.37% | 100.00% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 83.80% | 94.00% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 82.36% | 92.62% |
| CHEMBL4247 | Q9UM73 | ALK tyrosine kinase receptor | 82.15% | 96.86% |
| CHEMBL4940 | P07195 | L-lactate dehydrogenase B chain | 82.05% | 95.53% |
| CHEMBL2581 | P07339 | Cathepsin D | 81.97% | 98.95% |
| CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 81.69% | 91.03% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 81.27% | 94.45% |
| CHEMBL1871 | P10275 | Androgen Receptor | 81.25% | 96.43% |
| CHEMBL5925 | P22413 | Ectonucleotide pyrophosphatase/phosphodiesterase family member 1 | 81.01% | 92.38% |
| CHEMBL2041 | P07949 | Tyrosine-protein kinase receptor RET | 80.72% | 91.79% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 80.63% | 97.14% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Cryptocarya oubatchensis |
| Cryptocarya phyllostemon |
| Ficus septica |
| Vincetoxicum hirundinaria subsp. hirundinaria |
| PubChem | 5316514 |
| NPASS | NPC253883 |
| ChEMBL | CHEMBL244969 |
| LOTUS | LTS0156910 |
| wikiData | Q105177392 |