(2,3,5,6-Tetrahydroxycyclohexyl) 3,4,5-trihydroxybenzoate
| Internal ID | 202148c2-c3fb-460a-b125-59cc407a8c27 |
| Taxonomy | Benzenoids > Benzene and substituted derivatives > Benzoic acids and derivatives > Hydroxybenzoic acid derivatives > Gallic acid and derivatives > Galloyl esters |
| IUPAC Name | (2,3,5,6-tetrahydroxycyclohexyl) 3,4,5-trihydroxybenzoate |
| SMILES (Canonical) | C1C(C(C(C(C1O)O)OC(=O)C2=CC(=C(C(=C2)O)O)O)O)O |
| SMILES (Isomeric) | C1C(C(C(C(C1O)O)OC(=O)C2=CC(=C(C(=C2)O)O)O)O)O |
| InChI | InChI=1S/C13H16O9/c14-5-1-4(2-6(15)9(5)18)13(21)22-12-10(19)7(16)3-8(17)11(12)20/h1-2,7-8,10-12,14-20H,3H2 |
| InChI Key | VREUXABRPZUQPH-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C13H16O9 |
| Molecular Weight | 316.26 g/mol |
| Exact Mass | 316.07943208 g/mol |
| Topological Polar Surface Area (TPSA) | 168.00 Ų |
| XlogP | -1.60 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.73% | 91.11% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 96.80% | 91.49% |
| CHEMBL245 | P20309 | Muscarinic acetylcholine receptor M3 | 90.93% | 97.53% |
| CHEMBL3194 | P02766 | Transthyretin | 89.52% | 90.71% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 89.05% | 96.09% |
| CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 87.19% | 95.64% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 86.44% | 97.09% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 85.33% | 90.00% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 83.56% | 97.21% |
| CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 83.40% | 83.00% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 82.79% | 89.00% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 82.31% | 92.94% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 82.11% | 91.19% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 82.02% | 96.95% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 82.00% | 99.17% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.11% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 163016007 |
| LOTUS | LTS0083292 |
| wikiData | Q105291718 |