2,3,5-trimethoxy-6-(6,7,8-trimethoxy-3,4-dihydro-2H-chromen-3-yl)cyclohexa-2,5-diene-1,4-dione
Internal ID | ebf7bb8f-be24-41c3-8169-cade223fd278 |
Taxonomy | Phenylpropanoids and polyketides > Isoflavonoids > Isoflavanquinones |
IUPAC Name | 2,3,5-trimethoxy-6-(6,7,8-trimethoxy-3,4-dihydro-2H-chromen-3-yl)cyclohexa-2,5-diene-1,4-dione |
SMILES (Canonical) | COC1=C(C(=C2C(=C1)CC(CO2)C3=C(C(=O)C(=C(C3=O)OC)OC)OC)OC)OC |
SMILES (Isomeric) | COC1=C(C(=C2C(=C1)CC(CO2)C3=C(C(=O)C(=C(C3=O)OC)OC)OC)OC)OC |
InChI | InChI=1S/C21H24O9/c1-24-12-8-10-7-11(9-30-16(10)21(29-6)17(12)25-2)13-14(22)19(27-4)20(28-5)15(23)18(13)26-3/h8,11H,7,9H2,1-6H3 |
InChI Key | WMZRGAYGZBGMMG-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C21H24O9 |
Molecular Weight | 420.40 g/mol |
Exact Mass | 420.14203234 g/mol |
Topological Polar Surface Area (TPSA) | 98.80 Ų |
XlogP | 2.30 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.21% | 95.56% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.19% | 91.11% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 94.16% | 94.45% |
CHEMBL2581 | P07339 | Cathepsin D | 89.42% | 98.95% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.96% | 86.33% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 87.65% | 94.00% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 87.48% | 85.14% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 86.80% | 97.14% |
CHEMBL4247 | Q9UM73 | ALK tyrosine kinase receptor | 86.09% | 96.86% |
CHEMBL2535 | P11166 | Glucose transporter | 84.17% | 98.75% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 83.99% | 97.09% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 83.14% | 96.09% |
CHEMBL2094127 | P06493 | Cyclin-dependent kinase 1/cyclin B | 81.58% | 96.00% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 81.53% | 93.40% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 81.35% | 99.23% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 80.30% | 93.99% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Abrus precatorius |
PubChem | 56776396 |
LOTUS | LTS0140663 |
wikiData | Q105308937 |