2,3,4,9-Tetrahydro-6-hydroxy-1H-pyrido(3,4-b)indol-1-one
| Internal ID | d9c0641c-03ff-45e2-8ca8-69c70c6906a1 |
| Taxonomy | Organoheterocyclic compounds > Indoles and derivatives > Pyridoindoles > Beta carbolines |
| IUPAC Name | 6-hydroxy-2,3,4,9-tetrahydropyrido[3,4-b]indol-1-one |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C11H10N2O2/c14-6-1-2-9-8(5-6)7-3-4-12-11(15)10(7)13-9/h1-2,5,13-14H,3-4H2,(H,12,15) |
| InChI Key | WNGPRJOWLUNBCE-UHFFFAOYSA-N |
| Popularity | 10 references in papers |
| Molecular Formula | C11H10N2O2 |
| Molecular Weight | 202.21 g/mol |
| Exact Mass | 202.074227566 g/mol |
| Topological Polar Surface Area (TPSA) | 65.10 Ų |
| XlogP | 1.30 |
| EINECS 256-961-3 |
| 2,3,4,9-Tetrahydro-6-hydroxy-1H-pyrido(3,4-b)indol-1-one |
| 6-hydroxy-2,3,4,9-tetrahydropyrido[3,4-b]indol-1-one |
| 2,3,4,9-Tetrahydro-6-hydroxy-1H-pyrido[3,4-b]indol-1-one |
| CHEMBL397215 |
| 6-hydroxy-3,4-dihydro-1-oxo-beta-carboline |
| Q2S3LRG4YH |
| SCHEMBL1655185 |
| DTXSID00199089 |
| WNGPRJOWLUNBCE-UHFFFAOYSA-N |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.05% | 91.11% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 97.26% | 91.49% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 95.81% | 94.45% |
| CHEMBL2535 | P11166 | Glucose transporter | 94.24% | 98.75% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.06% | 95.56% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 90.91% | 98.59% |
| CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 90.36% | 91.71% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 90.28% | 89.00% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 89.49% | 93.99% |
| CHEMBL2094127 | P06493 | Cyclin-dependent kinase 1/cyclin B | 89.09% | 96.00% |
| CHEMBL2581 | P07339 | Cathepsin D | 88.32% | 98.95% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 85.80% | 94.75% |
| CHEMBL5443 | O00311 | Cell division cycle 7-related protein kinase | 84.93% | 96.11% |
| CHEMBL3310 | Q96DB2 | Histone deacetylase 11 | 83.31% | 88.56% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 83.25% | 85.14% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 83.16% | 97.09% |
| CHEMBL2292 | Q13627 | Dual-specificity tyrosine-phosphorylation regulated kinase 1A | 81.95% | 93.24% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 81.92% | 83.82% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 81.80% | 99.23% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 81.02% | 96.09% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 80.37% | 93.10% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 6452337 |
| LOTUS | LTS0085896 |
| wikiData | Q83071988 |