(2,8-Diacetyloxy-7-hydroxy-5,9-dimethyl-4-propanoyloxy-11-prop-1-en-2-yl-16-oxatetracyclo[7.5.2.01,10.03,7]hexadec-12-en-14-yl) benzoate
| Internal ID | 3be1121b-8eb9-45ad-84d2-a8ec6a570d04 |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Tetracarboxylic acids and derivatives |
| IUPAC Name | (2,8-diacetyloxy-7-hydroxy-5,9-dimethyl-4-propanoyloxy-11-prop-1-en-2-yl-16-oxatetracyclo[7.5.2.01,10.03,7]hexadec-12-en-14-yl) benzoate |
| SMILES (Canonical) | CCC(=O)OC1C(CC2(C1C(C34COC(C3C(C=CC4OC(=O)C5=CC=CC=C5)C(=C)C)(C2OC(=O)C)C)OC(=O)C)O)C |
| SMILES (Isomeric) | CCC(=O)OC1C(CC2(C1C(C34COC(C3C(C=CC4OC(=O)C5=CC=CC=C5)C(=C)C)(C2OC(=O)C)C)OC(=O)C)O)C |
| InChI | InChI=1S/C34H42O10/c1-8-25(37)44-27-19(4)16-34(39)26(27)29(41-20(5)35)33-17-40-32(7,31(34)42-21(6)36)28(33)23(18(2)3)14-15-24(33)43-30(38)22-12-10-9-11-13-22/h9-15,19,23-24,26-29,31,39H,2,8,16-17H2,1,3-7H3 |
| InChI Key | ALVBKAVOAAMXPJ-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C34H42O10 |
| Molecular Weight | 610.70 g/mol |
| Exact Mass | 610.27779753 g/mol |
| Topological Polar Surface Area (TPSA) | 135.00 Ų |
| XlogP | 4.50 |
| There are no found synonyms. |
![2D Structure of (2,8-Diacetyloxy-7-hydroxy-5,9-dimethyl-4-propanoyloxy-11-prop-1-en-2-yl-16-oxatetracyclo[7.5.2.01,10.03,7]hexadec-12-en-14-yl) benzoate](https://plantaedb.com/storage/docs/compounds/2023/11/2348d200-8572-11ee-90ea-e1439631c166.jpg "2D Structure of (2,8-Diacetyloxy-7-hydroxy-5,9-dimethyl-4-propanoyloxy-11-prop-1-en-2-yl-16-oxatetracyclo[7.5.2.01,10.03,7]hexadec-12-en-14-yl) benzoate")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.54% | 96.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 96.95% | 98.95% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 96.61% | 97.25% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.31% | 91.11% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 96.23% | 90.17% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 94.51% | 86.33% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 91.39% | 91.49% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 89.89% | 96.95% |
| CHEMBL5028 | O14672 | ADAM10 | 86.82% | 97.50% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.45% | 95.56% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 84.60% | 99.17% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 83.39% | 99.23% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 81.90% | 83.82% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 81.88% | 97.09% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 81.63% | 89.00% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 80.53% | 91.19% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Euphorbia seguieriana |
| Hypericum pseudopetiolatum |
| PubChem | 162977277 |
| LOTUS | LTS0094750 |
| wikiData | Q105113273 |