2,3,3-Trimethyl-2,5-dihydrofuro[3,2-c]quinolin-4-one
| Internal ID | 3ebeecbc-14b9-4e32-8ca0-c82153ced1e5 |
| Taxonomy | Organoheterocyclic compounds > Quinolines and derivatives > Dihydrofuranoquinolines |
| IUPAC Name | 2,3,3-trimethyl-2,5-dihydrofuro[3,2-c]quinolin-4-one |
| SMILES (Canonical) | CC1C(C2=C(O1)C3=CC=CC=C3NC2=O)(C)C |
| SMILES (Isomeric) | CC1C(C2=C(O1)C3=CC=CC=C3NC2=O)(C)C |
| InChI | InChI=1S/C14H15NO2/c1-8-14(2,3)11-12(17-8)9-6-4-5-7-10(9)15-13(11)16/h4-8H,1-3H3,(H,15,16) |
| InChI Key | PPZXOPMDXFKQOX-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C14H15NO2 |
| Molecular Weight | 229.27 g/mol |
| Exact Mass | 229.110278721 g/mol |
| Topological Polar Surface Area (TPSA) | 38.30 Ų |
| XlogP | 2.40 |
| There are no found synonyms. |
![2D Structure of 2,3,3-Trimethyl-2,5-dihydrofuro[3,2-c]quinolin-4-one](https://plantaedb.com/storage/docs/compounds/2023/11/233-trimethyl-25-dihydrofuro32-cquinolin-4-one.jpg "2D Structure of 2,3,3-Trimethyl-2,5-dihydrofuro[3,2-c]quinolin-4-one")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 96.75% | 95.56% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.17% | 91.11% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 94.20% | 99.23% |
| CHEMBL2581 | P07339 | Cathepsin D | 89.57% | 98.95% |
| CHEMBL3310 | Q96DB2 | Histone deacetylase 11 | 87.20% | 88.56% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 86.62% | 94.75% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 86.16% | 93.99% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 85.77% | 90.08% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 85.49% | 96.09% |
| CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 84.84% | 94.80% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.35% | 89.00% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 84.30% | 97.14% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 82.94% | 94.00% |
| CHEMBL2535 | P11166 | Glucose transporter | 82.83% | 98.75% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 82.67% | 94.45% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 82.56% | 85.14% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 81.94% | 94.73% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 81.88% | 97.09% |
| CHEMBL2717 | Q9HCR9 | Phosphodiesterase 11A | 81.02% | 85.00% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 80.96% | 93.31% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Euxylophora paraensis |
| PubChem | 162850260 |
| LOTUS | LTS0265159 |
| wikiData | Q105213121 |