8-Oxopseudopalmatine
| Internal ID | dd886b72-e2de-46ac-a46a-fb62583b4d2f |
| Taxonomy | Organoheterocyclic compounds > Isoquinolines and derivatives > Isoquinolones and derivatives |
| IUPAC Name | 2,3,10,11-tetramethoxy-5,6-dihydroisoquinolino[2,1-b]isoquinolin-8-one |
| SMILES (Canonical) | COC1=C(C=C2C(=C1)CCN3C2=CC4=CC(=C(C=C4C3=O)OC)OC)OC |
| SMILES (Isomeric) | COC1=C(C=C2C(=C1)CCN3C2=CC4=CC(=C(C=C4C3=O)OC)OC)OC |
| InChI | InChI=1S/C21H21NO5/c1-24-17-8-12-5-6-22-16(14(12)10-19(17)26-3)7-13-9-18(25-2)20(27-4)11-15(13)21(22)23/h7-11H,5-6H2,1-4H3 |
| InChI Key | RNYYLJRCLSSAOZ-UHFFFAOYSA-N |
| Popularity | 3 references in papers |
| Molecular Formula | C21H21NO5 |
| Molecular Weight | 367.40 g/mol |
| Exact Mass | 367.14197277 g/mol |
| Topological Polar Surface Area (TPSA) | 57.20 Ų |
| XlogP | 3.10 |
| NSC693145 |
| 2,3,10,11-tetramethoxy-5,6-dihydroisoquinolino[3,2-a]isoquinolin-8-one |
| CHEMBL1407265 |
| 2,3,10,11-tetramethoxy-5,6-dihydroisoquinolino[2,1-b]isoquinolin-8-one |
| AKOS040740216 |
| NSC-693145 |
| NCGC00160189-01 |
| NCI60_033376 |
| NCGC00160189-01!8-OXO-PSEUDOPALMATINE |
| 8H-Dibenzo[a, 5,6-dihydro- 2,3,10,11-tetramethoxy- |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 96.69% | 92.94% |
| CHEMBL2581 | P07339 | Cathepsin D | 94.10% | 98.95% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.77% | 95.56% |
| CHEMBL5925 | P22413 | Ectonucleotide pyrophosphatase/phosphodiesterase family member 1 | 93.43% | 92.38% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 92.66% | 93.40% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.54% | 96.09% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 91.30% | 85.14% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 91.18% | 94.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.06% | 86.33% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 86.85% | 93.99% |
| CHEMBL2535 | P11166 | Glucose transporter | 85.85% | 98.75% |
| CHEMBL2056 | P21728 | Dopamine D1 receptor | 85.55% | 91.00% |
| CHEMBL4895 | P30530 | Tyrosine-protein kinase receptor UFO | 83.15% | 90.95% |
| CHEMBL4940 | P07195 | L-lactate dehydrogenase B chain | 82.20% | 95.53% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 81.88% | 89.63% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 80.87% | 90.00% |
| CHEMBL5747 | Q92793 | CREB-binding protein | 80.69% | 95.12% |
| CHEMBL3746 | P80365 | 11-beta-hydroxysteroid dehydrogenase 2 | 80.36% | 94.78% |
| CHEMBL4835 | P00338 | L-lactate dehydrogenase A chain | 80.24% | 95.34% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Stephania suberosa |
| PubChem | 392605 |
| LOTUS | LTS0071454 |
| wikiData | Q105241931 |