2,3,10-trimethoxy-6,8,13,13a-tetrahydro-5H-isoquinolino[2,1-b]isoquinoline-1,11-diol
| Internal ID | 9bec1b60-83eb-4e5e-aa29-3cb4782d76c3 |
| Taxonomy | Alkaloids and derivatives > Protoberberine alkaloids and derivatives |
| IUPAC Name | 2,3,10-trimethoxy-6,8,13,13a-tetrahydro-5H-isoquinolino[2,1-b]isoquinoline-1,11-diol |
| SMILES (Canonical) | COC1=C(C(=C2C3CC4=CC(=C(C=C4CN3CCC2=C1)OC)O)O)OC |
| SMILES (Isomeric) | COC1=C(C(=C2C3CC4=CC(=C(C=C4CN3CCC2=C1)OC)O)O)OC |
| InChI | InChI=1S/C20H23NO5/c1-24-16-9-13-10-21-5-4-11-8-17(25-2)20(26-3)19(23)18(11)14(21)6-12(13)7-15(16)22/h7-9,14,22-23H,4-6,10H2,1-3H3 |
| InChI Key | GBJVLRZOHDGIGJ-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C20H23NO5 |
| Molecular Weight | 357.40 g/mol |
| Exact Mass | 357.15762283 g/mol |
| Topological Polar Surface Area (TPSA) | 71.40 Ų |
| XlogP | 2.60 |
| There are no found synonyms. |
![2D Structure of 2,3,10-trimethoxy-6,8,13,13a-tetrahydro-5H-isoquinolino[2,1-b]isoquinoline-1,11-diol](https://plantaedb.com/storage/docs/compounds/2023/11/2310-trimethoxy-681313a-tetrahydro-5h-isoquinolino21-bisoquinoline-111-diol.jpg "2D Structure of 2,3,10-trimethoxy-6,8,13,13a-tetrahydro-5H-isoquinolino[2,1-b]isoquinoline-1,11-diol")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.93% | 96.09% |
| CHEMBL217 | P14416 | Dopamine D2 receptor | 97.50% | 95.62% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.67% | 91.11% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 90.76% | 92.94% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 90.15% | 85.14% |
| CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 89.36% | 91.03% |
| CHEMBL2041 | P07949 | Tyrosine-protein kinase receptor RET | 88.97% | 91.79% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 88.69% | 95.89% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.60% | 86.33% |
| CHEMBL2056 | P21728 | Dopamine D1 receptor | 88.28% | 91.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.21% | 95.56% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 86.79% | 83.82% |
| CHEMBL2581 | P07339 | Cathepsin D | 86.74% | 98.95% |
| CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 86.66% | 82.38% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 85.97% | 95.89% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 85.48% | 94.45% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 85.10% | 90.00% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 84.35% | 94.00% |
| CHEMBL1744525 | P43490 | Nicotinamide phosphoribosyltransferase | 84.08% | 96.25% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 82.95% | 93.99% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 82.54% | 90.71% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 82.21% | 89.62% |
| CHEMBL3438 | Q05513 | Protein kinase C zeta | 81.76% | 88.48% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 81.73% | 99.17% |
| CHEMBL4247 | Q9UM73 | ALK tyrosine kinase receptor | 81.48% | 96.86% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 80.75% | 93.40% |
| CHEMBL5747 | Q92793 | CREB-binding protein | 80.16% | 95.12% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Stephania suberosa |
| PubChem | 162984722 |
| LOTUS | LTS0075830 |
| wikiData | Q105005897 |