2,3-Dimethylpyridine
| Internal ID | 74ca7d8d-6cb5-44ef-a4ca-254494af2a13 |
| Taxonomy | Organoheterocyclic compounds > Pyridines and derivatives > Methylpyridines |
| IUPAC Name | 2,3-dimethylpyridine |
| SMILES (Canonical) | CC1=C(N=CC=C1)C |
| SMILES (Isomeric) | CC1=C(N=CC=C1)C |
| InChI | InChI=1S/C7H9N/c1-6-4-3-5-8-7(6)2/h3-5H,1-2H3 |
| InChI Key | HPYNZHMRTTWQTB-UHFFFAOYSA-N |
| Popularity | 920 references in papers |
| Molecular Formula | C7H9N |
| Molecular Weight | 107.15 g/mol |
| Exact Mass | 107.073499291 g/mol |
| Topological Polar Surface Area (TPSA) | 12.90 Ų |
| XlogP | 1.60 |
| 2,3-DIMETHYLPYRIDINE |
| 583-61-9 |
| DIMETHYLPYRIDINE |
| Pyridine, 2,3-dimethyl- |
| 2,3-dimethyl-pyridine |
| 27175-64-0 |
| 5Q0F649H6G |
| NSC-2157 |
| Pyridine, dimethyl- |
| 350818-65-4 |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3401 | O75469 | Pregnane X receptor | 91.84% | 94.73% |
| CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 88.11% | 93.65% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.48% | 95.56% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 85.19% | 93.10% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 82.83% | 96.00% |
| CHEMBL3524 | P56524 | Histone deacetylase 4 | 82.72% | 92.97% |
| CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 82.30% | 100.00% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 80.84% | 94.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Nicotiana tabacum |
| PubChem | 11420 |
| LOTUS | LTS0099261 |
| wikiData | Q27262718 |