2,3-Dimethyl-6-propan-2-ylcyclohexan-1-one
Internal ID | 4c54e191-7022-4e9e-9702-ba54f12e46cf |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Monoterpenoids > Menthane monoterpenoids |
IUPAC Name | 2,3-dimethyl-6-propan-2-ylcyclohexan-1-one |
SMILES (Canonical) | CC1CCC(C(=O)C1C)C(C)C |
SMILES (Isomeric) | CC1CCC(C(=O)C1C)C(C)C |
InChI | InChI=1S/C11H20O/c1-7(2)10-6-5-8(3)9(4)11(10)12/h7-10H,5-6H2,1-4H3 |
InChI Key | ZKFQRZOHMMMCRQ-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C11H20O |
Molecular Weight | 168.28 g/mol |
Exact Mass | 168.151415257 g/mol |
Topological Polar Surface Area (TPSA) | 17.10 Ų |
XlogP | 3.30 |
DTXSID001263986 |
2,3-Dimethyl-6-(1-methylethyl)cyclohexanone |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2581 | P07339 | Cathepsin D | 94.08% | 98.95% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 85.87% | 97.25% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 85.65% | 97.09% |
CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 85.47% | 96.38% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 85.06% | 94.80% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 84.53% | 95.56% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 83.20% | 90.71% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 82.90% | 96.09% |
CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 82.83% | 96.47% |
CHEMBL4803 | P29474 | Nitric-oxide synthase, endothelial | 82.53% | 86.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.51% | 95.89% |
CHEMBL5203 | P33316 | dUTP pyrophosphatase | 80.07% | 99.18% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Cupressus bakeri |
PubChem | 60088108 |
LOTUS | LTS0102405 |
wikiData | Q105378420 |