2,3-Dimethoxypyrido[2,3-b]pyrazine
| Internal ID | 07c68715-1c40-4f4c-b2ba-b91f076cbbfa |
| Taxonomy | Organoheterocyclic compounds > Pyridopyrazines |
| IUPAC Name | 2,3-dimethoxypyrido[2,3-b]pyrazine |
| SMILES (Canonical) | COC1=NC2=C(N=CC=C2)N=C1OC |
| SMILES (Isomeric) | COC1=NC2=C(N=CC=C2)N=C1OC |
| InChI | InChI=1S/C9H9N3O2/c1-13-8-9(14-2)12-7-6(11-8)4-3-5-10-7/h3-5H,1-2H3 |
| InChI Key | AOLULOKZOGPFJI-UHFFFAOYSA-N |
| Popularity | 3 references in papers |
| Molecular Formula | C9H9N3O2 |
| Molecular Weight | 191.19 g/mol |
| Exact Mass | 191.069476538 g/mol |
| Topological Polar Surface Area (TPSA) | 57.10 Ų |
| XlogP | 1.10 |
| 103518-15-6 |
| SCHEMBL14506731 |
| AKOS027369168 |
| Z1255428660 |
![2D Structure of 2,3-Dimethoxypyrido[2,3-b]pyrazine](https://plantaedb.com/storage/docs/compounds/2023/11/23-dimethoxypyrido23-bpyrazine.jpg "2D Structure of 2,3-Dimethoxypyrido[2,3-b]pyrazine")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 93.47% | 86.33% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 89.74% | 94.00% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 89.04% | 96.00% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 87.41% | 96.09% |
| CHEMBL2535 | P11166 | Glucose transporter | 86.42% | 98.75% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 85.29% | 93.10% |
| CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 84.69% | 100.00% |
| CHEMBL3524 | P56524 | Histone deacetylase 4 | 84.53% | 92.97% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 83.63% | 91.11% |
| CHEMBL4306 | P22460 | Voltage-gated potassium channel subunit Kv1.5 | 83.30% | 94.03% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 82.22% | 93.99% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 81.38% | 90.00% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 81.22% | 94.73% |
| CHEMBL4145 | Q9UKV0 | Histone deacetylase 9 | 81.20% | 85.49% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 81.01% | 91.49% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 58881905 |
| LOTUS | LTS0218622 |
| wikiData | Q104915780 |