2,3-Dihydroxycyclopentaneundecanoic acid
| Internal ID | c81024ae-4a2e-4ba0-a1e9-cffcef2d2770 |
| Taxonomy | Lipids and lipid-like molecules > Fatty Acyls > Fatty acids and conjugates > Long-chain fatty acids |
| IUPAC Name | 11-(2,3-dihydroxycyclopentyl)undecanoic acid |
| SMILES (Canonical) | C1CC(C(C1CCCCCCCCCCC(=O)O)O)O |
| SMILES (Isomeric) | C1CC(C(C1CCCCCCCCCCC(=O)O)O)O |
| InChI | InChI=1S/C16H30O4/c17-14-12-11-13(16(14)20)9-7-5-3-1-2-4-6-8-10-15(18)19/h13-14,16-17,20H,1-12H2,(H,18,19) |
| InChI Key | NHWAOBNJSBDJAL-UHFFFAOYSA-N |
| Popularity | 4 references in papers |
| Molecular Formula | C16H30O4 |
| Molecular Weight | 286.41 g/mol |
| Exact Mass | 286.21440943 g/mol |
| Topological Polar Surface Area (TPSA) | 77.80 Ų |
| XlogP | 3.70 |
| RefChem:81770 |
| 11-(2,3-dihydroxycyclopentyl)undecanoic acid |
| MLS002667633 |
| 6938-15-4 |
| NCIOpen2_002558 |
| CHEMBL1886938 |
| CHEBI:79511 |
| DTXSID80989162 |
| HMS3080M16 |
| NSC53903 |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 99.24% | 83.82% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.27% | 96.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 93.80% | 98.95% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 92.88% | 91.11% |
| CHEMBL5285 | Q99683 | Mitogen-activated protein kinase kinase kinase 5 | 89.19% | 92.26% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 88.67% | 99.17% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 87.64% | 92.50% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 85.91% | 97.09% |
| CHEMBL2179 | P04062 | Beta-glucocerebrosidase | 83.38% | 85.31% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 82.21% | 93.00% |
| CHEMBL217 | P14416 | Dopamine D2 receptor | 81.54% | 95.62% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 81.49% | 95.89% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 80.51% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 243756 |
| LOTUS | LTS0097376 |
| wikiData | Q27148598 |