2,3-Dihydroxy-5-(6-hydroxyhepta-1,3-dienyl)-6-(hydroxymethyl)cyclohexan-1-one
| Internal ID | 36337767-c413-4203-8586-0548b5a35b6d |
| Taxonomy | Lipids and lipid-like molecules > Fatty Acyls > Fatty alcohols |
| IUPAC Name | 2,3-dihydroxy-5-(6-hydroxyhepta-1,3-dienyl)-6-(hydroxymethyl)cyclohexan-1-one |
| SMILES (Canonical) | CC(CC=CC=CC1CC(C(C(=O)C1CO)O)O)O |
| SMILES (Isomeric) | CC(CC=CC=CC1CC(C(C(=O)C1CO)O)O)O |
| InChI | InChI=1S/C14H22O5/c1-9(16)5-3-2-4-6-10-7-12(17)14(19)13(18)11(10)8-15/h2-4,6,9-12,14-17,19H,5,7-8H2,1H3 |
| InChI Key | QUDYXYAJFSPMCL-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C14H22O5 |
| Molecular Weight | 270.32 g/mol |
| Exact Mass | 270.14672380 g/mol |
| Topological Polar Surface Area (TPSA) | 98.00 Ų |
| XlogP | 0.20 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 96.62% | 85.14% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 96.24% | 83.82% |
| CHEMBL2581 | P07339 | Cathepsin D | 93.91% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.59% | 96.09% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.58% | 95.56% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 87.11% | 97.09% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 86.58% | 97.25% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 85.62% | 95.93% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 84.42% | 96.47% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 81.88% | 91.11% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 80.67% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 162858375 |
| LOTUS | LTS0090121 |
| wikiData | Q105228113 |