2',3'-Dihydroxy-4',6'-dimethoxychalcone
| Internal ID | 27abe5b7-3a42-4082-8b62-a6fd1f344164 |
| Taxonomy | Phenylpropanoids and polyketides > Linear 1,3-diarylpropanoids > Chalcones and dihydrochalcones > 2-Hydroxychalcones |
| IUPAC Name | (E)-1-(2,3-dihydroxy-4,6-dimethoxyphenyl)-3-phenylprop-2-en-1-one |
| SMILES (Canonical) | COC1=CC(=C(C(=C1C(=O)C=CC2=CC=CC=C2)O)O)OC |
| SMILES (Isomeric) | COC1=CC(=C(C(=C1C(=O)/C=C/C2=CC=CC=C2)O)O)OC |
| InChI | InChI=1S/C17H16O5/c1-21-13-10-14(22-2)16(19)17(20)15(13)12(18)9-8-11-6-4-3-5-7-11/h3-10,19-20H,1-2H3/b9-8+ |
| InChI Key | IAYOHSHBLLHXFB-CMDGGOBGSA-N |
| Popularity | 10 references in papers |
| Molecular Formula | C17H16O5 |
| Molecular Weight | 300.30 g/mol |
| Exact Mass | 300.09977361 g/mol |
| Topological Polar Surface Area (TPSA) | 76.00 Ų |
| XlogP | 3.50 |
| MLS000863647 |
| SMR000440760 |
| 54299-64-8 |
| (E)-1-(2,3-dihydroxy-4,6-dimethoxyphenyl)-3-phenylprop-2-en-1-one |
| MEGxp0_001483 |
| CHEMBL1446527 |
| ACon1_000124 |
| BDBM47548 |
| cid_14159747 |
| HMS2269H13 |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.30% | 91.11% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 96.85% | 86.33% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.30% | 95.56% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 94.37% | 96.00% |
| CHEMBL2002 | P12268 | Inosine-5'-monophosphate dehydrogenase 2 | 93.18% | 98.21% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.78% | 96.09% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 87.54% | 95.50% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 85.97% | 90.20% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 84.52% | 99.17% |
| CHEMBL3194 | P02766 | Transthyretin | 84.00% | 90.71% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 82.93% | 90.00% |
| CHEMBL2535 | P11166 | Glucose transporter | 81.25% | 98.75% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 80.95% | 93.99% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 80.75% | 94.73% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Piper hispidum |
| Uvaria dulcis |
| PubChem | 14159747 |
| LOTUS | LTS0100820 |
| wikiData | Q76423622 |